CID 21603987
Internal ID | 25b175fa-6e83-4757-b77e-69e1ff9c4add |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1S,17S,19S)-9-hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C3CC(CC4N3CCCC4)OC(=O)CCC5=CC2=C(C=C5)O)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)[C@@H]3C[C@H](C[C@H]4N3CCCC4)OC(=O)CCC5=CC2=C(C=C5)O)OC |
InChI | InChI=1S/C26H31NO5/c1-30-24-14-19-20(15-25(24)31-2)22-13-18(12-17-5-3-4-10-27(17)22)32-26(29)9-7-16-6-8-23(28)21(19)11-16/h6,8,11,14-15,17-18,22,28H,3-5,7,9-10,12-13H2,1-2H3/t17-,18-,22-/m0/s1 |
InChI Key | CUPVWBKZXUQNOL-SPEDKVCISA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H31NO5 |
Molecular Weight | 437.50 g/mol |
Exact Mass | 437.22022309 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 4.30 |
(1S,17S,19S)-9-Hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
SCHEMBL1183643 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.33% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.20% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.41% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.20% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.13% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.95% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.96% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.96% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.78% | 99.15% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.33% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.18% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.80% | 85.14% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.80% | 90.24% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.61% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.37% | 90.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.32% | 93.04% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.43% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.45% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.41% | 89.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.27% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.63% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.41% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.41% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.14% | 94.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.00% | 82.67% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 81.03% | 93.33% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.27% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Decodon verticillatus |
Lagerstroemia indica |
Lythrum alatum var. lanceolatum |
PubChem | 21603987 |
LOTUS | LTS0100620 |
wikiData | Q104970424 |