CID 14312560
Internal ID | 97938d68-131e-486b-8f0b-06646e3e5295 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | |
SMILES (Canonical) | CC(=O)C=C=C1C(CC(CC1(C)OC2C(C(C(C(O2)CO)O)O)O)O)(C)C |
SMILES (Isomeric) | CC(=O)C=C=C1C(CC(CC1(C)OC2C(C(C(C(O2)CO)O)O)O)O)(C)C |
InChI | InChI=1S/C19H30O8/c1-10(21)5-6-13-18(2,3)7-11(22)8-19(13,4)27-17-16(25)15(24)14(23)12(9-20)26-17/h5,11-12,14-17,20,22-25H,7-9H2,1-4H3 |
InChI Key | XTODSGVDHGMKSN-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H30O8 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | -1.60 |
CID 14312560 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.59% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.14% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.76% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.76% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.69% | 86.92% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.04% | 91.24% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.40% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.95% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.15% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.60% | 95.83% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.14% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 14312560 |
LOTUS | LTS0193227 |
wikiData | Q105341734 |