CID 13343541
Internal ID | 99b344fd-8222-4994-9624-e18c589706a8 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxychromen-2-one |
SMILES (Canonical) | CC(=C)C(CC1=C(C=CC2=C1OC(=O)C=C2)OC)O |
SMILES (Isomeric) | CC(=C)[C@H](CC1=C(C=CC2=C1OC(=O)C=C2)OC)O |
InChI | InChI=1S/C15H16O4/c1-9(2)12(16)8-11-13(18-3)6-4-10-5-7-14(17)19-15(10)11/h4-7,12,16H,1,8H2,2-3H3/t12-/m0/s1 |
InChI Key | SQSRYWNOKPJENY-LBPRGKRZSA-N |
Popularity | 5 references in papers |
Molecular Formula | C15H16O4 |
Molecular Weight | 260.28 g/mol |
Exact Mass | 260.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.80 |
1221-43-8 |
CID 13343541 |
8-[(2S)-2-hydroxy-3-methylbut-3-enyl]-7-methoxychromen-2-one |
8-[(2S)-2-Hydroxy-3-methyl-3-buten-1-yl]-7-methoxy-2H-1-benzopyran-2-one; (+)-Auraptenol;2H-1-Benzopyran-2-one, 8-(2-hydroxy-3-methyl-3-butenyl)-7-methoxy-, (S)-; 2H-1-Benzopyran-2-one, 8-[(2S)-2-hydroxy-3-methyl-3-butenyl]-7-methoxy- |
HY-N2910 |
AKOS040760282 |
FS-10243 |
CS-0023508 |
(S)-8-(2-Hydroxy-3-methylbut-3-en-1-yl)-7-methoxy-2H-chromen-2-one |
2H-1-Benzopyran-2-one, 8-[(2S)-2-hydroxy-3-methyl-3-buten-1-yl]-7-methoxy- |
![2D Structure of CID 13343541 2D Structure of CID 13343541](https://plantaedb.com/storage/docs/compounds/2023/11/cid-13343541.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.62% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.47% | 90.20% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.66% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.19% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.64% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.54% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.18% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.08% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.82% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.47% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.21% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena anisata |
Cnidium monnieri |
Ferula moschata |
Murraya paniculata |
Prangos pabularia |
PubChem | 13343541 |
LOTUS | LTS0021110 |
wikiData | Q104394143 |