Chloroquine
Internal ID | bbd226f0-c398-4b79-9495-950c09f392bc |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Aminoquinolines and derivatives > 4-aminoquinolines |
IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
SMILES (Canonical) | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl |
SMILES (Isomeric) | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl |
InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) |
InChI Key | WHTVZRBIWZFKQO-UHFFFAOYSA-N |
Popularity | 32,567 references in papers |
Molecular Formula | C18H26ClN3 |
Molecular Weight | 319.90 g/mol |
Exact Mass | 319.1815255 g/mol |
Topological Polar Surface Area (TPSA) | 28.20 Ų |
XlogP | 4.60 |
54-05-7 |
Aralen |
Chlorochin |
Chloraquine |
Artrichin |
Chloroquina |
Chloroquinium |
Capquin |
Reumachlor |
Chemochin |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL240 | Q12809 | HERG |
2500 nM 2500 nM 2500 nM |
IC50 IC50 IC50 |
PMID: 11012023
PMID: 14640511 via CMAUP |
CHEMBL4869 | P04156 | Prion protein |
4000 nM |
EC50 |
PMID: 22037378
|
CHEMBL3959 | P16083 | Quinone reductase 2 |
1500 nM |
IC50 |
via CMAUP
|
CHEMBL287 | Q99720 | Sigma opioid receptor |
79.43 nM |
Ki |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
10 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 98.19% | 89.76% |
CHEMBL3401 | O75469 | Pregnane X receptor | 97.01% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 96.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.63% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.32% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.82% | 91.11% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 91.57% | 100.00% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 90.86% | 90.00% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 90.57% | 89.92% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.26% | 97.23% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.85% | 95.93% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.21% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.99% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.27% | 90.17% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.50% | 89.44% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.35% | 93.81% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.17% | 96.90% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.96% | 98.59% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.95% | 92.29% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.87% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.28% | 90.71% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.11% | 92.97% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.84% | 86.33% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.03% | 99.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 82.29% | 92.50% |
CHEMBL3232685 | O00257 | E3 SUMO-protein ligase CBX4 | 81.10% | 93.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.22% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alkanna orientalis |
Cinchona calisaya |
Montanoa tomentosa |
PubChem | 2719 |
NPASS | NPC476464 |
ChEMBL | CHEMBL76 |
LOTUS | LTS0192132 |
wikiData | Q105305166 |