Capsaicin
Internal ID | 1bf6a75d-36aa-415d-8ec9-3ddf443a46de |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide |
SMILES (Canonical) | CC(C)C=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ |
InChI Key | YKPUWZUDDOIDPM-SOFGYWHQSA-N |
Popularity | 18,784 references in papers |
Molecular Formula | C18H27NO3 |
Molecular Weight | 305.40 g/mol |
Exact Mass | 305.19909372 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | 3.79 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 9 |
404-86-4 |
Zostrix |
(E)-Capsaicin |
Qutenza |
CAPSAICINE |
Axsain |
Styptysat |
Isodecenoic acid vanillylamide |
Ausanil |
trans-Capsaicin |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9906 | 99.06% |
Caco-2 | - | 0.6205 | 62.05% |
Blood Brain Barrier | + | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.9272 | 92.72% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8679 | 86.79% |
OATP1B3 inhibitior | + | 0.9404 | 94.04% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | + | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.8872 | 88.72% |
P-glycoprotein inhibitior | - | 0.8841 | 88.41% |
P-glycoprotein substrate | - | 0.7628 | 76.28% |
CYP3A4 substrate | + | 0.5094 | 50.94% |
CYP2C9 substrate | + | 0.6153 | 61.53% |
CYP2D6 substrate | - | 0.7925 | 79.25% |
CYP3A4 inhibition | + | 0.8287 | 82.87% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | + | 0.6667 | 66.67% |
CYP inhibitory promiscuity | - | 0.7551 | 75.51% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8071 | 80.71% |
Carcinogenicity (trinary) | Non-required | 0.6924 | 69.24% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.5473 | 54.73% |
Skin irritation | + | 0.5683 | 56.83% |
Skin corrosion | - | 0.9425 | 94.25% |
Ames mutagenesis | - | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8643 | 86.43% |
Micronuclear | - | 0.5800 | 58.00% |
Hepatotoxicity | - | 0.9323 | 93.23% |
skin sensitisation | - | 0.8775 | 87.75% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.7889 | 78.89% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.8599 | 85.99% |
Acute Oral Toxicity (c) | III | 0.6676 | 66.76% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | - | 0.6803 | 68.03% |
Thyroid receptor binding | + | 0.8461 | 84.61% |
Glucocorticoid receptor binding | - | 0.6040 | 60.40% |
Aromatase binding | - | 0.5481 | 54.81% |
PPAR gamma | + | 0.6998 | 69.98% |
Honey bee toxicity | - | 0.8898 | 88.98% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.6765 | 67.65% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM 15848.9 nM 28183.8 nM 22387.2 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL221 | P23219 | Cyclooxygenase-1 |
3800 nM 1551 nM |
IC50 IC50 |
PMID: 16038536
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
3000 nM |
IC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
39810.7 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
15848.9 nM 17782.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
22387.2 nM |
Potency |
via CMAUP
|
CHEMBL4794 | Q8NER1 | Vanilloid receptor |
28.2 nM 2.512 nM 8 nM |
EC50 EC50 IC50 |
via Super-PRED
via Super-PRED PMID: 25666822 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.08% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.78% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 96.98% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.40% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.41% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.68% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.25% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.14% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.03% | 90.24% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.14% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.86% | 99.15% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.95% | 96.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.89% | 90.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.37% | 98.11% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.20% | 92.88% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.90% | 97.29% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.53% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.43% | 94.73% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.58% | 89.33% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.14% | 96.25% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.97% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.58% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campsis grandiflora |
Capsicum annuum |
Capsicum annuum var. glabriusculum |
Capsicum pubescens |
Glehnia littoralis |
Mangifera indica |
PubChem | 1548943 |
NPASS | NPC255550 |
ChEMBL | CHEMBL294199 |
LOTUS | LTS0241286 |
wikiData | Q273169 |