Campesteryl acetate
Internal ID | e553edba-6656-4ac2-966b-39a782963a9b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C |
SMILES (Isomeric) | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C)C)C |
InChI | InChI=1S/C30H50O2/c1-19(2)20(3)8-9-21(4)26-12-13-27-25-11-10-23-18-24(32-22(5)31)14-16-29(23,6)28(25)15-17-30(26,27)7/h10,19-21,24-28H,8-9,11-18H2,1-7H3/t20-,21-,24+,25+,26-,27+,28+,29+,30-/m1/s1 |
InChI Key | JOBAYBRAHVTSSW-NTUCOQBPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O2 |
Molecular Weight | 442.70 g/mol |
Exact Mass | 442.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 9.40 |
Campesterol acetate |
Campesterol, acetate |
UNII-7PG68X5ECI |
7PG68X5ECI |
1900-53-4 |
Ergost-5-en-3-ol, acetate, (3beta,24R)- |
Ergost-5-en-3-ol, 3-acetate, (3beta,24R)- |
Ergost-5-en-3-ol, acetate, (3.beta.,24R)- |
[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
Ergost-5-en-3-yl acetate # |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.90% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.02% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.51% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.40% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.74% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.59% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.65% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.30% | 93.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.81% | 94.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.90% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.27% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 81.84% | 97.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.73% | 94.62% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.53% | 95.93% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.22% | 91.19% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.01% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.58% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.20% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baccharoides anthelmintica |
Cajanus cajan |
Dioscorea polystachya |
Neolitsea sericea |
Wrightia tinctoria |
Zea mays |
PubChem | 13019955 |
LOTUS | LTS0088991 |
wikiData | Q27268679 |