[6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-nona-1,3,5-trienyl-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate
| Internal ID | 442ec811-8072-4fad-88ab-f8550493f0fe |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Rhamnofolane and daphnane diterpenoids |
| IUPAC Name | [6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-nona-1,3,5-trienyl-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate |
| SMILES (Canonical) | CCCC=CC=CC=CC12OC3C4C5C(O5)(C(C6(C(C4(O1)C(C(C3(O2)C(=C)C)OC(=O)C7=CC=CC=C7)C)C=C(C6=O)C)O)O)CO |
| SMILES (Isomeric) | CCCC=CC=CC=CC12OC3C4C5C(O5)(C(C6(C(C4(O1)C(C(C3(O2)C(=C)C)OC(=O)C7=CC=CC=C7)C)C=C(C6=O)C)O)O)CO |
| InChI | InChI=1S/C37H42O10/c1-6-7-8-9-10-11-15-18-34-45-30-26-29-33(20-38,44-29)32(41)35(42)25(19-22(4)27(35)39)37(26,47-34)23(5)28(36(30,46-34)21(2)3)43-31(40)24-16-13-12-14-17-24/h8-19,23,25-26,28-30,32,38,41-42H,2,6-7,20H2,1,3-5H3 |
| InChI Key | SOUIDWZGKWVPTO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C37H42O10 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.27779753 g/mol |
| Topological Polar Surface Area (TPSA) | 144.00 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of [6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-nona-1,3,5-trienyl-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/c0b81830-86aa-11ee-946d-eb77c60757df.jpg "2D Structure of [6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-nona-1,3,5-trienyl-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.15% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.59% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.98% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.69% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.93% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.34% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.32% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.99% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.52% | 99.17% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.52% | 97.79% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.93% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.73% | 91.49% |
| CHEMBL5028 | O14672 | ADAM10 | 83.84% | 97.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.03% | 94.73% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.53% | 93.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.33% | 92.32% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.21% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Daphne acutiloba |
| Daphne genkwa |
| Daphne odora |
| PubChem | 162861794 |
| LOTUS | LTS0058630 |
| wikiData | Q105257212 |