Burchellin
Internal ID | a62902cd-436b-4604-bd94-279016382946 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
SMILES (Canonical) | CC1C(OC2=CC(=O)C(=CC12CC=C)OC)C3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | CC1C(OC2=CC(=O)C(=CC12CC=C)OC)C3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C20H20O5/c1-4-7-20-10-17(22-3)14(21)9-18(20)25-19(12(20)2)13-5-6-15-16(8-13)24-11-23-15/h4-6,8-10,12,19H,1,7,11H2,2-3H3 |
InChI Key | SOLJFAQVSWXZEQ-UHFFFAOYSA-N |
Popularity | 12 references in papers |
Molecular Formula | C20H20O5 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 3.80 |
38276-59-4 |
3a-Epiburchellin |
2-(1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
155551-61-4 |
NSC 370991 |
DTXSID20959203 |
NSC370991 |
NSC-370991 |
2-(2H-1,3-Benzodioxol-5-yl)-5-methoxy-3-methyl-3a-(prop-2-en-1-yl)-3,3a-dihydro-1-benzofuran-6(2H)-one |
6(2H)-Benzofuranone, 2-(1,3-benzodioxol-5-yl)-3,3a-dihydro-5-methoxy-3-methyl-3a-(2-propenyl)-, (2S-(2alpha,3beta,3abeta))- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.27% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.01% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.73% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.45% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.28% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.18% | 86.33% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 89.45% | 95.55% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.11% | 85.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.18% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 86.92% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.36% | 96.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.66% | 92.62% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.02% | 96.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.87% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.38% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.17% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.12% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.36% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aniba burchellii |
Aniba ferrea |
Licaria triandra |
Magnolia denudata |
Nectandra grandiflora |
Ocotea porosa |
Piper hymenophyllum |
Piper kadsura |
PubChem | 100199 |
LOTUS | LTS0084868 |
wikiData | Q82939849 |