Buddlenol C
Internal ID | 4616807b-a7f5-4b69-9e6e-f1d3c39d5b34 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 2-[4-[3-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-1-(4-hydroxy-3-methoxyphenyl)propane-1,3-diol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC(CO)C(C5=CC(=C(C=C5)O)OC)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC(CO)C(C5=CC(=C(C=C5)O)OC)O)OC |
InChI | InChI=1S/C32H38O12/c1-37-22-8-16(6-7-21(22)34)28(35)27(13-33)44-32-25(40-4)11-18(12-26(32)41-5)31-20-15-42-30(19(20)14-43-31)17-9-23(38-2)29(36)24(10-17)39-3/h6-12,19-20,27-28,30-31,33-36H,13-15H2,1-5H3 |
InChI Key | FITCDKVKQIBVRK-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C32H38O12 |
Molecular Weight | 614.60 g/mol |
Exact Mass | 614.23632664 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 2.40 |
NSC603538 |
G-b-S-r-S |
bmse010110 |
97465-73-1 |
NSC-603538 |
guaiacylglycerol beta-syringaresinol ether |
AC1L73A1 |
SCHEMBL15172307 |
CHEBI:86635 |
DTXSID201100495 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 95.08% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.37% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 91.81% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.19% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.51% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.50% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.98% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.57% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.50% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.07% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.01% | 96.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.12% | 100.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.91% | 92.68% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.71% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.85% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.93% | 98.75% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.85% | 85.49% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.04% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bambusa emeiensis |
Buddleja davidii |
Picrasma quassioides |
Populus tremula |
Senna occidentalis |
Tarenna attenuata |
PubChem | 353908 |
LOTUS | LTS0275742 |
wikiData | Q27105115 |