Blumenol C glucoside
Internal ID | 0789db01-83ac-4470-badc-ec4730469a6f |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | 3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohex-2-en-1-one |
SMILES (Canonical) | CC1=CC(=O)CC(C1CCC(C)OC2C(C(C(C(O2)CO)O)O)O)(C)C |
SMILES (Isomeric) | CC1=CC(=O)CC(C1CCC(C)OC2C(C(C(C(O2)CO)O)O)O)(C)C |
InChI | InChI=1S/C19H32O7/c1-10-7-12(21)8-19(3,4)13(10)6-5-11(2)25-18-17(24)16(23)15(22)14(9-20)26-18/h7,11,13-18,20,22-24H,5-6,8-9H2,1-4H3 |
InChI Key | NYLNHNDMNOPWAZ-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C19H32O7 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.21480336 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 0.30 |
Byzantioside B |
189109-45-3 |
9-epi-Blumenol C beta-D-glucopyranoside |
3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohex-2-en-1-one |
62512-23-6 |
9-epi-Blumenol C glucoside |
Blumenol C glucoside; Blumenol C beta-D-glucopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.69% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.26% | 97.25% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.76% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.11% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.91% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.72% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.82% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.45% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.32% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.99% | 100.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.90% | 83.57% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.10% | 96.47% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.55% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.15% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.42% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 14135394 |
LOTUS | LTS0085874 |
wikiData | Q104664622 |