(3S,4S)-4-[(Z)-1-carboxy-3-[[(1R,19R,21S,22R,23R)-6-(6-carboxy-2,3,4-trihydroxyphenoxy)-7,8,11,12,13,22-hexahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl]oxy]-3-oxoprop-1-en-2-yl]-5,6,7-trihydroxy-1-oxo-3,4-dihydroisochromene-3-carboxylic acid
Internal ID | 8eb4beed-ff7f-45ec-aebf-7f4bc593f7fc |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (3S,4S)-4-[(Z)-1-carboxy-3-[[(1R,19R,21S,22R,23R)-6-(6-carboxy-2,3,4-trihydroxyphenoxy)-7,8,11,12,13,22-hexahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl]oxy]-3-oxoprop-1-en-2-yl]-5,6,7-trihydroxy-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)OC6=C(C(=C(C=C6C(=O)O)O)O)O)OC(=O)C(=CC(=O)O)C7C(OC(=O)C8=CC(=C(C(=C78)O)O)O)C(=O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)OC6=C(C(=C(C=C6C(=O)O)O)O)O)OC(=O)/C(=C\C(=O)O)/[C@H]7[C@H](OC(=O)C8=CC(=C(C(=C78)O)O)O)C(=O)O |
InChI | InChI=1S/C48H34O33/c49-15-1-9(2-16(50)27(15)56)43(70)81-48-36(65)40-38(78-47(74)13(7-22(54)55)26-25-11(4-18(52)29(58)33(25)62)45(72)79-39(26)42(68)69)21(77-48)8-75-44(71)10-3-17(51)28(57)32(61)23(10)24-12(46(73)80-40)6-20(31(60)34(24)63)76-37-14(41(66)67)5-19(53)30(59)35(37)64/h1-7,21,26,36,38-40,48-53,56-65H,8H2,(H,54,55)(H,66,67)(H,68,69)/b13-7-/t21-,26-,36-,38-,39+,40-,48+/m1/s1 |
InChI Key | MOXIBUYRLMGMJE-YPWCFRPISA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H34O33 |
Molecular Weight | 1138.80 g/mol |
Exact Mass | 1138.0982335 g/mol |
Topological Polar Surface Area (TPSA) | 565.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.69% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.58% | 96.38% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 96.05% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.63% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 92.42% | 90.71% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 91.77% | 94.42% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.62% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.42% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.49% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.86% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.48% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.54% | 95.78% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.13% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.77% | 95.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.73% | 91.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.64% | 92.62% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.94% | 93.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.89% | 89.34% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.80% | 91.07% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 84.76% | 97.31% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.79% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 83.64% | 98.95% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.52% | 98.75% |
CHEMBL3891 | P07384 | Calpain 1 | 83.01% | 93.04% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.85% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.56% | 95.89% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 81.92% | 95.52% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.85% | 90.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.58% | 95.64% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.30% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.04% | 100.00% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.01% | 96.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.99% | 92.50% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.15% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mallotus repandus |
Phyllanthus amarus |
PubChem | 16170982 |
LOTUS | LTS0088175 |
wikiData | Q104403389 |