beta-D-glucosyl-N-(dodecanoyl)sphingosine
Internal ID | 62ec9ae7-e44a-4777-a392-7c1bc6ac8d58 |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids > Simple glycosylceramides > Glycosyl-N-acylsphingosines |
IUPAC Name | N-[(E,2S,3R)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadec-4-en-2-yl]dodecanamide |
SMILES (Canonical) | CCCCCCCCCCCCCC=CC(C(COC1C(C(C(C(O1)CO)O)O)O)NC(=O)CCCCCCCCCCC)O |
SMILES (Isomeric) | CCCCCCCCCCCCC/C=C/[C@H]([C@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)NC(=O)CCCCCCCCCCC)O |
InChI | InChI=1S/C36H69NO8/c1-3-5-7-9-11-13-14-15-16-18-19-21-23-25-30(39)29(28-44-36-35(43)34(42)33(41)31(27-38)45-36)37-32(40)26-24-22-20-17-12-10-8-6-4-2/h23,25,29-31,33-36,38-39,41-43H,3-22,24,26-28H2,1-2H3,(H,37,40)/b25-23+/t29-,30+,31+,33+,34-,35+,36+/m0/s1 |
InChI Key | IYCYEZLMOLRFAN-IUGLYQEMSA-N |
Popularity | 48 references in papers |
Molecular Formula | C36H69NO8 |
Molecular Weight | 643.90 g/mol |
Exact Mass | 643.50231816 g/mol |
Topological Polar Surface Area (TPSA) | 149.00 Ų |
XlogP | 9.10 |
Atomic LogP (AlogP) | 5.83 |
H-Bond Acceptor | 8 |
H-Bond Donor | 6 |
Rotatable Bonds | 29 |
D-glucosyl--1,1' N-lauroyl-D-erythro-sphingosine |
111956-48-0 |
C12 beta-GlcCer |
beta-GlcCer (C12) |
beta-GlcCer (C12:0) |
C12-beta-glucosyl ceramide |
CHEBI:76297 |
beta-D-glucosyl-N-dodecanoylsphing-4E-enine |
1-O-beta-D-glucopyranosyl-N-(dodecanoyl)sphingosine |
Q27145864 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5446 | 54.46% |
Caco-2 | - | 0.8678 | 86.78% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.7599 | 75.99% |
OATP2B1 inhibitior | - | 0.5651 | 56.51% |
OATP1B1 inhibitior | + | 0.8044 | 80.44% |
OATP1B3 inhibitior | + | 0.9225 | 92.25% |
MATE1 inhibitior | - | 0.9612 | 96.12% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.8414 | 84.14% |
P-glycoprotein inhibitior | + | 0.5976 | 59.76% |
P-glycoprotein substrate | - | 0.7604 | 76.04% |
CYP3A4 substrate | + | 0.6162 | 61.62% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8690 | 86.90% |
CYP3A4 inhibition | - | 0.6831 | 68.31% |
CYP2C9 inhibition | - | 0.9257 | 92.57% |
CYP2C19 inhibition | - | 0.8752 | 87.52% |
CYP2D6 inhibition | - | 0.8066 | 80.66% |
CYP1A2 inhibition | - | 0.8743 | 87.43% |
CYP2C8 inhibition | - | 0.6970 | 69.70% |
CYP inhibitory promiscuity | - | 0.8687 | 86.87% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.7098 | 70.98% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9196 | 91.96% |
Skin irritation | - | 0.7583 | 75.83% |
Skin corrosion | - | 0.9553 | 95.53% |
Ames mutagenesis | - | 0.8900 | 89.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7173 | 71.73% |
Micronuclear | - | 0.5100 | 51.00% |
Hepatotoxicity | - | 0.8750 | 87.50% |
skin sensitisation | - | 0.8789 | 87.89% |
Respiratory toxicity | - | 0.6222 | 62.22% |
Reproductive toxicity | + | 0.6778 | 67.78% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | + | 0.5000 | 50.00% |
Acute Oral Toxicity (c) | III | 0.6732 | 67.32% |
Estrogen receptor binding | + | 0.6970 | 69.70% |
Androgen receptor binding | - | 0.6713 | 67.13% |
Thyroid receptor binding | - | 0.6158 | 61.58% |
Glucocorticoid receptor binding | - | 0.6517 | 65.17% |
Aromatase binding | + | 0.5779 | 57.79% |
PPAR gamma | + | 0.5594 | 55.94% |
Honey bee toxicity | - | 0.8729 | 87.29% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | + | 0.5334 | 53.34% |
Fish aquatic toxicity | - | 0.4074 | 40.74% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.18% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.88% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.88% | 89.63% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.43% | 91.11% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.96% | 97.29% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.51% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.78% | 92.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 94.78% | 92.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.67% | 93.56% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 94.27% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.17% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.84% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.71% | 96.47% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.89% | 82.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.44% | 96.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.30% | 94.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.97% | 91.24% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.97% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.01% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.75% | 90.17% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.17% | 92.32% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.99% | 89.34% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.58% | 91.81% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.97% | 95.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.21% | 92.88% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.86% | 98.03% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.65% | 96.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.54% | 95.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.21% | 96.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.68% | 97.36% |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 80.49% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arisaema amurense |
Arisaema erubescens |
Arisaema heterophyllum |
Pinellia ternata |