beta-1,2,3,4,6-Penta-O-galloyl-D-glucopyranose
Internal ID | 3ac82855-6e27-465a-a2d9-fe4e8da31f8c |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5,6-tetrakis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@H]2[C@H]([C@@H]([C@@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O |
InChI | InChI=1S/C41H32O26/c42-17-1-12(2-18(43)28(17)52)36(57)62-11-27-33(64-37(58)13-3-19(44)29(53)20(45)4-13)34(65-38(59)14-5-21(46)30(54)22(47)6-14)35(66-39(60)15-7-23(48)31(55)24(49)8-15)41(63-27)67-40(61)16-9-25(50)32(56)26(51)10-16/h1-10,27,33-35,41-56H,11H2/t27-,33+,34-,35-,41-/m0/s1 |
InChI Key | QJYNZEYHSMRWBK-CGKDMBANSA-N |
Popularity | 44 references in papers |
Molecular Formula | C41H32O26 |
Molecular Weight | 940.70 g/mol |
Exact Mass | 940.11818112 g/mol |
Topological Polar Surface Area (TPSA) | 444.00 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | 1.69 |
H-Bond Acceptor | 26 |
H-Bond Donor | 15 |
Rotatable Bonds | 11 |
BETA-1,2,3,4,6-PENTA-O-GALLOYL-D-GLUCOPYRANOSE |
PD059955 |
[(2S,3R,4S,5S,6S)-3,4,5,6-tetrakis[(3,4,5-trihydroxybenzoyl)oxy]tetrahydropyran-2-yl]methyl 3,4,5-trihydroxybenzoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5975 | 59.75% |
Caco-2 | - | 0.8615 | 86.15% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.7179 | 71.79% |
OATP2B1 inhibitior | - | 0.8524 | 85.24% |
OATP1B1 inhibitior | - | 0.6970 | 69.70% |
OATP1B3 inhibitior | - | 0.5698 | 56.98% |
MATE1 inhibitior | + | 0.7000 | 70.00% |
OCT2 inhibitior | - | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.6662 | 66.62% |
P-glycoprotein inhibitior | + | 0.7578 | 75.78% |
P-glycoprotein substrate | - | 0.9615 | 96.15% |
CYP3A4 substrate | + | 0.5051 | 50.51% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8473 | 84.73% |
CYP3A4 inhibition | - | 0.8325 | 83.25% |
CYP2C9 inhibition | - | 0.7629 | 76.29% |
CYP2C19 inhibition | - | 0.8866 | 88.66% |
CYP2D6 inhibition | - | 0.9422 | 94.22% |
CYP1A2 inhibition | - | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.5719 | 57.19% |
CYP inhibitory promiscuity | - | 0.7781 | 77.81% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9300 | 93.00% |
Carcinogenicity (trinary) | Non-required | 0.7506 | 75.06% |
Eye corrosion | - | 0.9918 | 99.18% |
Eye irritation | - | 0.8654 | 86.54% |
Skin irritation | - | 0.8336 | 83.36% |
Skin corrosion | - | 0.9589 | 95.89% |
Ames mutagenesis | - | 0.8800 | 88.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8006 | 80.06% |
Micronuclear | + | 0.6966 | 69.66% |
Hepatotoxicity | - | 0.8500 | 85.00% |
skin sensitisation | - | 0.8119 | 81.19% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | + | 0.5444 | 54.44% |
Mitochondrial toxicity | - | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.9346 | 93.46% |
Acute Oral Toxicity (c) | III | 0.8042 | 80.42% |
Estrogen receptor binding | + | 0.7780 | 77.80% |
Androgen receptor binding | + | 0.7207 | 72.07% |
Thyroid receptor binding | + | 0.5343 | 53.43% |
Glucocorticoid receptor binding | + | 0.6237 | 62.37% |
Aromatase binding | - | 0.5453 | 54.53% |
PPAR gamma | + | 0.6902 | 69.02% |
Honey bee toxicity | - | 0.9138 | 91.38% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.6150 | 61.50% |
Fish aquatic toxicity | + | 0.9022 | 90.22% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4296326 | P58335 | Anthrax toxin receptor 2 |
58 nM 100 nM 300 nM |
IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED |
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
112.2 nM |
Potency |
via Super-PRED
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
501.2 nM |
Potency |
via Super-PRED
|
CHEMBL244 | P00742 | Coagulation factor X |
170 nM |
IC50 |
via Super-PRED
|
CHEMBL2392 | P06746 | DNA polymerase beta |
158.5 nM |
Potency |
via Super-PRED
|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
6.3 nM |
Potency |
via Super-PRED
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
177.8 nM |
Potency |
via Super-PRED
|
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 |
10 nM 3.1 nM 10 nM 10 nM 10 nM |
IC50 Kd IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED via Super-PRED via Super-PRED |
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
17.8 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.08% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.84% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 90.47% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.80% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.85% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.16% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.82% | 92.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.56% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.63% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.13% | 89.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.05% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 81.00% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.27% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ampelopsis japonica |
Angelica dahurica |
Paeonia suffruticosa |
Phyllanthus emblica |
Terminalia chebula |