Benzamide
Internal ID | bc2b97fa-3e7c-4507-a1aa-33314a776ff4 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
IUPAC Name | benzamide |
SMILES (Canonical) | C1=CC=C(C=C1)C(=O)N |
SMILES (Isomeric) | C1=CC=C(C=C1)C(=O)N |
InChI | InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
InChI Key | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
Popularity | 10,405 references in papers |
Molecular Formula | C7H7NO |
Molecular Weight | 121.14 g/mol |
Exact Mass | 121.052763847 g/mol |
Topological Polar Surface Area (TPSA) | 43.10 Ų |
XlogP | 0.60 |
Atomic LogP (AlogP) | 0.79 |
H-Bond Acceptor | 1 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
55-21-0 |
Benzoylamide |
Benzoic acid amide |
Phenylcarboxyamide |
Phenylcarboxamide |
Benzenecarboxamide |
Amid kyseliny benzoove |
NSC 3114 |
CCRIS 4594 |
Amid kyseliny benzoove [Czech] |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9972 | 99.72% |
Caco-2 | + | 0.9667 | 96.67% |
Blood Brain Barrier | + | 1.0000 | 100.00% |
Human oral bioavailability | + | 0.8714 | 87.14% |
Subcellular localzation | Lysosomes | 0.5913 | 59.13% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9853 | 98.53% |
OATP1B3 inhibitior | + | 0.9623 | 96.23% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.9341 | 93.41% |
P-glycoprotein inhibitior | - | 0.9890 | 98.90% |
P-glycoprotein substrate | - | 0.9908 | 99.08% |
CYP3A4 substrate | - | 0.8620 | 86.20% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8450 | 84.50% |
CYP3A4 inhibition | - | 0.9732 | 97.32% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.8894 | 88.94% |
CYP2C8 inhibition | - | 0.9410 | 94.10% |
CYP inhibitory promiscuity | - | 0.9301 | 93.01% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | + | 0.5200 | 52.00% |
Carcinogenicity (trinary) | Non-required | 0.5416 | 54.16% |
Eye corrosion | + | 0.7688 | 76.88% |
Eye irritation | + | 0.9974 | 99.74% |
Skin irritation | + | 0.4900 | 49.00% |
Skin corrosion | - | 0.9274 | 92.74% |
Ames mutagenesis | - | 0.9870 | 98.70% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.9165 | 91.65% |
Micronuclear | + | 0.6600 | 66.00% |
Hepatotoxicity | + | 0.7802 | 78.02% |
skin sensitisation | - | 0.8011 | 80.11% |
Respiratory toxicity | - | 0.6000 | 60.00% |
Reproductive toxicity | - | 0.5889 | 58.89% |
Mitochondrial toxicity | + | 0.6500 | 65.00% |
Nephrotoxicity | - | 0.5946 | 59.46% |
Acute Oral Toxicity (c) | III | 0.8931 | 89.31% |
Estrogen receptor binding | - | 0.9452 | 94.52% |
Androgen receptor binding | - | 0.8068 | 80.68% |
Thyroid receptor binding | - | 0.8384 | 83.84% |
Glucocorticoid receptor binding | - | 0.9116 | 91.16% |
Aromatase binding | - | 0.8639 | 86.39% |
PPAR gamma | - | 0.9065 | 90.65% |
Honey bee toxicity | - | 0.9886 | 98.86% |
Biodegradation | + | 0.5250 | 52.50% |
Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
Fish aquatic toxicity | - | 0.7682 | 76.82% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
2.8 nM 2.8 nM 2.8 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
251.2 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
5 nM 5 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
223.9 nM 223.9 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 |
20000 nM 22000 nM |
IC50 IC50 |
PMID: 12825952
PMID: 11689065 |
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
1258.9 nM 1258.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
100000 nM 35.5 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.72% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.19% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.45% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.23% | 91.11% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 85.28% | 93.81% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.63% | 94.62% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.01% | 89.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Colchicum autumnale |
Haplophyllum obtusifolium |
Houttuynia cordata |
Mortonia palmeri |
Paeonia peregrina |
Sarcomelicope argyrophylla |
PubChem | 2331 |
NPASS | NPC146703 |
ChEMBL | CHEMBL267373 |
LOTUS | LTS0145461 |
wikiData | Q417731 |