5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | d16a10db-76dc-4db8-9a18-ac7f0d7a206c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)O)O |
InChI | InChI=1S/C22H22O11/c1-30-15-4-9(2-3-11(15)24)14-7-13(26)18-12(25)5-10(6-16(18)32-14)31-22-21(29)20(28)19(27)17(8-23)33-22/h2-7,17,19-25,27-29H,8H2,1H3/t17-,19+,20-,21+,22+/m0/s1 |
InChI Key | GAMYVSCDDLXAQW-AOIWZFSPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.39% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.20% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.91% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.16% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.12% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.57% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.72% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.50% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.05% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.79% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 88.71% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.17% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.33% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.77% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.08% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.97% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.93% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.44% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.97% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.95% | 97.36% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.74% | 93.31% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.39% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Apium graveolens |
Commelina communis |
Dioscorea oppositifolia |
Echinops ritro |
Salvia palaestina |
Saussurea medusa |
Stachys alopecuros |
PubChem | 154496342 |
LOTUS | LTS0269750 |
wikiData | Q105005484 |