(1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-(benzoyloxymethyl)-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid
| Internal ID | c7b04ed5-479f-4e0c-9ef3-eee2cdd3cb30 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-(benzoyloxymethyl)-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)COC(=O)C6=CC=CC=C6)C)(C)C)O)C)C(=O)O |
| SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)COC(=O)C6=CC=CC=C6)C)(C)C)O)C)C(=O)O |
| InChI | InChI=1S/C37H52O5/c1-23(2)25-14-19-36(32(40)41)20-21-37(22-42-31(39)24-10-8-7-9-11-24)26(30(25)36)12-13-28-34(5)17-16-29(38)33(3,4)27(34)15-18-35(28,37)6/h7-11,25-30,38H,1,12-22H2,2-6H3,(H,40,41)/t25-,26+,27-,28+,29-,30+,34-,35+,36-,37-/m0/s1 |
| InChI Key | UOOCKKIJUDJHOV-OZLSVLHISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C37H52O5 |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.38147475 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 9.00 |
| There are no found synonyms. |
![2D Structure of (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-(benzoyloxymethyl)-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/b1d19310-861d-11ee-8940-cb3bb90f73a4.jpg "2D Structure of (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-(benzoyloxymethyl)-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.53% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.94% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.57% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.90% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.22% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.85% | 97.79% |
| CHEMBL5028 | O14672 | ADAM10 | 88.67% | 97.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.45% | 95.93% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.37% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.79% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.74% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.50% | 100.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.04% | 92.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.39% | 95.89% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.15% | 92.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eurycoma longifolia |
| Helicteres angustifolia |
| PubChem | 11692717 |
| LOTUS | LTS0089470 |
| wikiData | Q105270159 |