Azaleatin
Internal ID | 8ba8305c-d45c-41e4-ba08-f0be6939299a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxychromen-4-one |
SMILES (Canonical) | COC1=CC(=CC2=C1C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O |
InChI | InChI=1S/C16H12O7/c1-22-11-5-8(17)6-12-13(11)14(20)15(21)16(23-12)7-2-3-9(18)10(19)4-7/h2-6,17-19,21H,1H3 |
InChI Key | RJBAXROZAXAEEM-UHFFFAOYSA-N |
Popularity | 8 references in papers |
Molecular Formula | C16H12O7 |
Molecular Weight | 316.26 g/mol |
Exact Mass | 316.05830272 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 1.30 |
529-51-1 |
5-O-Methylquercetin |
Quercetin 5-methyl ether |
3,3',4',7-Tetrahydroxy-5-methoxyflavone |
5-O-Methyl Quercetin |
2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxychromen-4-one |
CHEBI:2945 |
CHEMBL470848 |
2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-4H-chromen-4-one |
SO52512D8G |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1250375 | Q9NPH5 | NADPH oxidase 4 |
740 nM |
IC50 |
PMID: 20731357
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.44% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.17% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.54% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.67% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.66% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 91.83% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.26% | 95.56% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.09% | 98.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.08% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.91% | 94.45% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.24% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.14% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.89% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.18% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.16% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.09% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.01% | 85.14% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.41% | 94.42% |
CHEMBL2424 | Q04760 | Glyoxalase I | 80.91% | 91.67% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.06% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281604 |
NPASS | NPC270465 |
ChEMBL | CHEMBL470848 |
LOTUS | LTS0108572 |
wikiData | Q2875086 |