Avenacin B-2
Internal ID | e313f7dd-f864-4f9a-9adc-3b31f34b140b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1S,3R,5R,6R,9S,11R,14R,15S,17S,18S,20S,21R,23R)-21-formyl-17-hydroxy-9-[(2S,3R,4S,5S)-4-hydroxy-3,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]oxan-2-yl]oxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-20-yl] benzoate |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)CO)O)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)C)CC7C8(C3(CC(C9(C8CC(C(C9)OC(=O)C1=CC=CC=C1)(C)C=O)C)O)C)O7)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2C[C@@H]4[C@]5([C@]3(C[C@@H]([C@@]6([C@H]5C[C@@]([C@H](C6)OC(=O)C7=CC=CC=C7)(C)C=O)C)O)C)O4)C)(C)C)O[C@H]8[C@@H]([C@H]([C@H](CO8)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
InChI | InChI=1S/C54H80O20/c1-48(2)29-13-16-52(6)30(17-34-54(74-34)31-18-49(3,24-57)35(71-44(66)25-11-9-8-10-12-25)20-51(31,5)32(58)19-53(52,54)7)50(29,4)15-14-33(48)72-47-43(73-46-42(65)40(63)37(60)27(22-56)69-46)38(61)28(23-67-47)70-45-41(64)39(62)36(59)26(21-55)68-45/h8-12,24,26-43,45-47,55-56,58-65H,13-23H2,1-7H3/t26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36-,37-,38+,39+,40+,41-,42-,43-,45+,46+,47+,49+,50+,51+,52-,53+,54-/m1/s1 |
InChI Key | RTMPAEPNXWUCGZ-ITFDNFFVSA-N |
Popularity | 7 references in papers |
Molecular Formula | C54H80O20 |
Molecular Weight | 1049.20 g/mol |
Exact Mass | 1048.52429494 g/mol |
Topological Polar Surface Area (TPSA) | 314.00 Ų |
XlogP | 2.00 |
90547-93-6 |
[(1S,3R,5R,6R,9S,11R,14R,15S,17S,18S,20S,21R,23R)-21-formyl-17-hydroxy-9-[(2S,3R,4S,5S)-4-hydroxy-3,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]oxan-2-yl]oxy-6,10,10,14,15,18,21-heptamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-20-yl] benzoate |
C08927 |
CHEBI:2936 |
DTXSID60331665 |
Q27105891 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.53% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.89% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.92% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.70% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.29% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.24% | 97.09% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 93.04% | 89.44% |
CHEMBL5028 | O14672 | ADAM10 | 92.67% | 97.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 92.58% | 94.23% |
CHEMBL2581 | P07339 | Cathepsin D | 92.32% | 98.95% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.28% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.88% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.55% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.95% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.20% | 99.17% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.83% | 97.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.63% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.86% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.84% | 97.14% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.81% | 89.67% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.23% | 90.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.00% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.24% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arrhenatherum elatius |
Avena sativa |
PubChem | 441908 |
NPASS | NPC134452 |
LOTUS | LTS0098699 |
wikiData | Q27105891 |