Artoheterophyllin B
Internal ID | 25af4469-a076-4abd-a1ab-6c6f6207778f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | 2,3,8,10-tetrahydroxy-9,11-bis(3-methylbut-2-enyl)-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C4=CC(=C(C=C4OC3C=C(C)C)O)O)CC=C(C)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C4=CC(=C(C=C4OC3C=C(C)C)O)O)CC=C(C)C)O)C |
InChI | InChI=1S/C30H32O7/c1-14(2)7-9-17-26(33)18(10-8-15(3)4)29-25(27(17)34)28(35)24-23(11-16(5)6)36-22-13-21(32)20(31)12-19(22)30(24)37-29/h7-8,11-13,23,31-34H,9-10H2,1-6H3 |
InChI Key | MOPJKKUUKHCZPG-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H32O7 |
Molecular Weight | 504.60 g/mol |
Exact Mass | 504.21480336 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 7.40 |
1174017-37-8 |
Cyclorigidol |
CHEMBL1096731 |
2,3,8,10-tetrahydroxy-9,11-bis(3-methylbut-2-enyl)-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
BDBM50317862 |
AKOS032961769 |
FS-10192 |
F92916 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 95.30% | 89.34% |
CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.98% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.99% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.72% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.50% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.61% | 91.49% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.79% | 98.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.54% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.91% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.18% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.13% | 94.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.52% | 94.42% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus heterophyllus |
Artocarpus styracifolius |
PubChem | 44226791 |
LOTUS | LTS0086233 |
wikiData | Q105169052 |