Aristololactam IIIa
Internal ID | fd32c401-d2ae-4121-8113-2875aef7d5d9 |
Taxonomy | Alkaloids and derivatives > Aristolactams |
IUPAC Name | 16-hydroxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one |
SMILES (Canonical) | C1OC2=C(O1)C3=C4C=C(C=CC4=CC5=C3C(=C2)C(=O)N5)O |
SMILES (Isomeric) | C1OC2=C(O1)C3=C4C=C(C=CC4=CC5=C3C(=C2)C(=O)N5)O |
InChI | InChI=1S/C16H9NO4/c18-8-2-1-7-3-11-13-10(16(19)17-11)5-12-15(21-6-20-12)14(13)9(7)4-8/h1-5,18H,6H2,(H,17,19) |
InChI Key | XCYLMCOZDQCDRH-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C16H9NO4 |
Molecular Weight | 279.25 g/mol |
Exact Mass | 279.05315777 g/mol |
Topological Polar Surface Area (TPSA) | 67.80 Ų |
XlogP | 2.80 |
CHEMBL607579 |
BDBM50306877 |
HY-N11564 |
CS-0649606 |
10-Hydroxy-6H-benzo[f][1,3]dioxolo[4'',5'':4,5]benzo[1,2,3-cd]indol-5-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 |
2150 nM |
IC50 |
PMID: 20097066
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.41% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.87% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 92.79% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.36% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.42% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.23% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.99% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.95% | 83.10% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.81% | 91.49% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.58% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.47% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.45% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.27% | 93.40% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.19% | 92.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.05% | 99.15% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.03% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.75% | 90.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.38% | 85.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.36% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aristolochia contorta |
Aristolochia debilis |
Aristolochia kaempferi |
PubChem | 5319620 |
NPASS | NPC112676 |
ChEMBL | CHEMBL607579 |
LOTUS | LTS0192481 |
wikiData | Q105325548 |