Arecoline
Internal ID | f96d3502-9735-4fbe-9dd9-06a40144b159 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate |
SMILES (Canonical) | CN1CCC=C(C1)C(=O)OC |
SMILES (Isomeric) | CN1CCC=C(C1)C(=O)OC |
InChI | InChI=1S/C8H13NO2/c1-9-5-3-4-7(6-9)8(10)11-2/h4H,3,5-6H2,1-2H3 |
InChI Key | HJJPJSXJAXAIPN-UHFFFAOYSA-N |
Popularity | 2,532 references in papers |
Molecular Formula | C8H13NO2 |
Molecular Weight | 155.19 g/mol |
Exact Mass | 155.094628657 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 0.30 |
Atomic LogP (AlogP) | 0.42 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 1 |
63-75-2 |
Arecolin |
Arecaline |
Arecholine |
Methylarecaiden |
Methylarecaidin |
Arekolin |
Arecoline base |
Arecaidine methyl ester |
3-Pyridinecarboxylic acid, 1,2,5,6-tetrahydro-1-methyl-, methyl ester |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9244 | 92.44% |
Caco-2 | + | 0.9559 | 95.59% |
Blood Brain Barrier | + | 0.8250 | 82.50% |
Human oral bioavailability | + | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.5352 | 53.52% |
OATP2B1 inhibitior | - | 0.8475 | 84.75% |
OATP1B1 inhibitior | + | 0.9619 | 96.19% |
OATP1B3 inhibitior | + | 0.9457 | 94.57% |
MATE1 inhibitior | - | 0.8200 | 82.00% |
OCT2 inhibitior | + | 0.6500 | 65.00% |
BSEP inhibitior | - | 0.9331 | 93.31% |
P-glycoprotein inhibitior | - | 0.9908 | 99.08% |
P-glycoprotein substrate | - | 0.8762 | 87.62% |
CYP3A4 substrate | - | 0.6190 | 61.90% |
CYP2C9 substrate | - | 0.8060 | 80.60% |
CYP2D6 substrate | - | 0.7040 | 70.40% |
CYP3A4 inhibition | - | 0.9820 | 98.20% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9061 | 90.61% |
CYP2D6 inhibition | - | 0.9230 | 92.30% |
CYP1A2 inhibition | - | 0.9045 | 90.45% |
CYP2C8 inhibition | - | 0.9673 | 96.73% |
CYP inhibitory promiscuity | - | 0.9564 | 95.64% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8200 | 82.00% |
Carcinogenicity (trinary) | Non-required | 0.6491 | 64.91% |
Eye corrosion | - | 0.8227 | 82.27% |
Eye irritation | + | 0.7637 | 76.37% |
Skin irritation | + | 0.4915 | 49.15% |
Skin corrosion | - | 0.6782 | 67.82% |
Ames mutagenesis | + | 0.7400 | 74.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5997 | 59.97% |
Micronuclear | - | 0.8600 | 86.00% |
Hepatotoxicity | + | 0.6659 | 66.59% |
skin sensitisation | - | 0.7411 | 74.11% |
Respiratory toxicity | + | 0.6000 | 60.00% |
Reproductive toxicity | - | 0.6333 | 63.33% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | + | 0.4724 | 47.24% |
Acute Oral Toxicity (c) | III | 0.7876 | 78.76% |
Estrogen receptor binding | - | 0.9711 | 97.11% |
Androgen receptor binding | - | 0.7878 | 78.78% |
Thyroid receptor binding | - | 0.8920 | 89.20% |
Glucocorticoid receptor binding | - | 0.9127 | 91.27% |
Aromatase binding | - | 0.8288 | 82.88% |
PPAR gamma | - | 0.9407 | 94.07% |
Honey bee toxicity | - | 0.9706 | 97.06% |
Biodegradation | + | 0.7500 | 75.00% |
Crustacea aquatic toxicity | - | 0.7600 | 76.00% |
Fish aquatic toxicity | + | 0.7315 | 73.15% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 |
65000 nM 115 nM 115500 nM 545 nM 145000 nM |
IC50 IC50 IC50 IC50 IC50 |
PMID: 9435896
PMID: 11597415 PMID: 11597415 PMID: 1433209 PMID: 9438027 |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 |
1800 nM 40 nM 4500 nM |
IC50 Ki IC50 |
PMID: 9435896
via Super-PRED PMID: 9438027 |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 |
58000 nM 11000 nM |
IC50 IC50 |
PMID: 9438027
PMID: 9435896 |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 |
26 nM 13500 nM 47500 nM |
Ki IC50 IC50 |
via Super-PRED
PMID: 9435896 PMID: 9438027 |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 |
62500 nM |
IC50 |
PMID: 9438027
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
1000 nM |
Potency |
via CMAUP
|
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
35.5 nM 35.5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 95.92% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.26% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.21% | 85.14% |
CHEMBL4072 | P07858 | Cathepsin B | 83.74% | 93.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.87% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Areca catechu |
Piper betle |
PubChem | 2230 |
NPASS | NPC14437 |
ChEMBL | CHEMBL7303 |
LOTUS | LTS0116578 |
wikiData | Q423515 |