Apigenin 7-O-methylglucuronide
Internal ID | 999f1417-6174-434a-9bf5-7024ad5f0f4d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | methyl 3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylate |
SMILES (Canonical) | COC(=O)C1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)O)O)O |
SMILES (Isomeric) | COC(=O)C1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)O)O)O |
InChI | InChI=1S/C22H20O11/c1-30-21(29)20-18(27)17(26)19(28)22(33-20)31-11-6-12(24)16-13(25)8-14(32-15(16)7-11)9-2-4-10(23)5-3-9/h2-8,17-20,22-24,26-28H,1H3 |
InChI Key | XXKIWCKZQFBXIR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H20O11 |
Molecular Weight | 460.40 g/mol |
Exact Mass | 460.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | 1.40 |
Apigenin7-O-methylglucuronide |
CHEMBL2005982 |
AKOS032948757 |
NSC-622810 |
NCI60_006772 |
PD183941 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.25% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.68% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.00% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.51% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.29% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.48% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.90% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.19% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.68% | 94.45% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 87.75% | 89.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.15% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.72% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 84.77% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.12% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.80% | 99.17% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.35% | 95.64% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.34% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aster indicus |
Bellis perennis |
Broussonetia papyrifera |
Centaurea urvillei |
Helichrysum arenarium |
Hyssopus officinalis |
Meehania fargesii |
Ocimum tenuiflorum |
PubChem | 5387369 |
LOTUS | LTS0167320 |
wikiData | Q104399893 |