8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
Internal ID | 0ccbb519-c10f-44c9-94a9-59c163e7f7de |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O |
SMILES (Isomeric) | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O |
InChI | InChI=1S/C30H20O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-10,12,25,31-36H,11H2/t25-/m0/s1 |
InChI Key | JVBCTBWKMWXQQO-VWLOTQADSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H20O10 |
Molecular Weight | 540.50 g/mol |
Exact Mass | 540.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 4.80 |
BDBM50323210 |
AKOS040762693 |
![2D Structure of 8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one 2D Structure of 8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/07/af552510-24fc-11ee-b335-297420ca7b34.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4822 | P56817 | Beta-secretase 1 |
750 nM |
IC50 |
PMID: 20598535
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 98.46% | 98.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.18% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.85% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 95.31% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 94.61% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.17% | 96.21% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 94.08% | 85.11% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 93.77% | 97.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.70% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.93% | 97.09% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 90.86% | 91.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.28% | 94.00% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 89.76% | 91.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.85% | 95.56% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.75% | 88.48% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 87.52% | 89.23% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.98% | 95.78% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 86.58% | 91.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.08% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.11% | 91.71% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.75% | 96.12% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.72% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.95% | 95.89% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.59% | 95.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.53% | 86.92% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.22% | 96.95% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.55% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.54% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.06% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 44420106 |
NPASS | NPC66441 |
ChEMBL | CHEMBL220741 |
LOTUS | LTS0243265 |
wikiData | Q105135557 |