Adoxoside
Internal ID | 65693f2b-6011-436b-a9aa-e6c9e0e9a911 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,7S,7aS)-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | COC(=O)C1=COC(C2C1CCC2CO)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1CC[C@@H]2CO)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C17H26O10/c1-24-15(23)9-6-25-16(11-7(4-18)2-3-8(9)11)27-17-14(22)13(21)12(20)10(5-19)26-17/h6-8,10-14,16-22H,2-5H2,1H3/t7-,8-,10-,11-,12-,13+,14-,16+,17+/m1/s1 |
InChI Key | MAHXAEHBKGBEBY-OBFZKGLGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O10 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -1.40 |
methyl (1S,4aS,7S,7aS)-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
42830-26-2 |
MEGxp0_000854 |
AKOS040763276 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.97% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.87% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.29% | 86.92% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.08% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.35% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 86.23% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.67% | 96.61% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.76% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.15% | 96.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.69% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Castilleja integra |
Castilleja sessiliflora |
Cordylanthus tenuis |
Fagraea blumei |
Fouquieria splendens |
Orthocarpus tolmiei |
Patrinia gibbosa |
Penstemon secundiflorus |
Viburnum japonicum |
PubChem | 11079666 |
LOTUS | LTS0269850 |
wikiData | Q104396408 |