2-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-5-[(E)-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxamide
Internal ID | adc6fd69-3b3d-4166-ae8e-c717ea281e10 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-5-[(E)-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxamide |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2C(=O)NCCC3=CC=C(C=C3)O)C4=CC(=C(C=C4)O)OC)C=CC(=O)NCCC5=CC=C(C=C5)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1OC(C2C(=O)NCCC3=CC=C(C=C3)O)C4=CC(=C(C=C4)O)OC)/C=C/C(=O)NCCC5=CC=C(C=C5)O |
InChI | InChI=1S/C36H36N2O8/c1-44-30-21-25(8-13-29(30)41)34-33(36(43)38-18-16-23-5-11-27(40)12-6-23)28-19-24(20-31(45-2)35(28)46-34)7-14-32(42)37-17-15-22-3-9-26(39)10-4-22/h3-14,19-21,33-34,39-41H,15-18H2,1-2H3,(H,37,42)(H,38,43)/b14-7+ |
InChI Key | DROXVBRNXCRUHP-VGOFMYFVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C36H36N2O8 |
Molecular Weight | 624.70 g/mol |
Exact Mass | 624.24716611 g/mol |
Topological Polar Surface Area (TPSA) | 147.00 Ų |
XlogP | 4.90 |
Tataramide B |
80510-06-1 |
2-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-5-[(E)-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxamide |
Tribulusamide A |
Grossamide or its isomer (Not validated) |
()-Grossamide |
187655-56-7 |
(+-)-Grossamide |
rel-(2R,3R)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-5-[(1E)-3-[[2-(4-hydroxyphenyl)ethyl]amino]-3-oxo-1-propen-1-yl]-7-methoxy-3-benzofurancarboxamide |
NSC359837 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.77% | 96.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 95.51% | 85.31% |
CHEMBL2581 | P07339 | Cathepsin D | 93.42% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.29% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.27% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.18% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.55% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.44% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.13% | 94.45% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.55% | 97.14% |
CHEMBL236 | P41143 | Delta opioid receptor | 88.84% | 99.35% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.27% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.68% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.46% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.28% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.16% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.06% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.93% | 97.93% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.82% | 89.67% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.82% | 89.33% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.76% | 96.67% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.65% | 90.20% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 82.46% | 97.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.24% | 90.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.85% | 97.21% |
CHEMBL3194 | P02766 | Transthyretin | 80.93% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.34% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona crassiflora |
Cannabis sativa |
Capsicum annuum |
Hyoscyamus niger |
Tribulus terrestris |
PubChem | 5322012 |
LOTUS | LTS0237225 |
wikiData | Q104987561 |