2-[4-Hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | d8e947da-2872-4c50-914f-3b5d106eedde |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[4-hydroxy-2,3-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CC(CO)C(CC2=CC(=C(C(=C2)OC)O)OC)COC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CC(CO)C(CC2=CC(=C(C(=C2)OC)O)OC)COC3C(C(C(C(O3)CO)O)O)O |
InChI | InChI=1S/C28H40O13/c1-36-18-7-14(8-19(37-2)23(18)31)5-16(11-29)17(6-15-9-20(38-3)24(32)21(10-15)39-4)13-40-28-27(35)26(34)25(33)22(12-30)41-28/h7-10,16-17,22,25-35H,5-6,11-13H2,1-4H3 |
InChI Key | OTSJYDFFIUXMJK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H40O13 |
Molecular Weight | 584.60 g/mol |
Exact Mass | 584.24689133 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.97% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.28% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.66% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.50% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.88% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.97% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.30% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.83% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.53% | 94.73% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.95% | 90.20% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.70% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.10% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.96% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.95% | 97.36% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.57% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capparis flavicans |
Strobilanthes cusia |
PubChem | 74105562 |
LOTUS | LTS0052586 |
wikiData | Q105199785 |