2-[4-[3-(4-Hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 02fba40f-0551-406c-86b9-89db61fa93a3 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[4-[3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C=C5)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C=C5)O)OC |
InChI | InChI=1S/C27H34O12/c1-33-17-6-12(4-5-16(17)29)24-14-10-37-25(15(14)11-36-24)13-7-18(34-2)26(19(8-13)35-3)39-27-23(32)22(31)21(30)20(9-28)38-27/h4-8,14-15,20-25,27-32H,9-11H2,1-3H3 |
InChI Key | GLGVEKKQPFRBAS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O12 |
Molecular Weight | 550.60 g/mol |
Exact Mass | 550.20502652 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.56% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.64% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.52% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.83% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.74% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.21% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.81% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.95% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 87.60% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.06% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.23% | 96.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.88% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.52% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.48% | 92.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.46% | 99.15% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.09% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daphne feddei |
Daphne oleoides |
Vitex glabrata |
PubChem | 4485344 |
LOTUS | LTS0194734 |
wikiData | Q105010916 |