1-[(1R,3R,8S,9S,10R,13S,14S)-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone
Internal ID | ef01a8ab-ca01-4fee-9542-5dce6b08f05b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 1-[(1R,3R,8S,9S,10R,13S,14S)-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CC(CC4=CCC5C(C34C)CCC6(C5CC=C6C(=O)C)C)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@@H]3C[C@@H](CC4=CC[C@@H]5[C@@H]([C@@]34C)CC[C@]6([C@H]5CC=C6C(=O)C)C)O)O)O)O)O)O |
InChI | InChI=1S/C32H48O11/c1-14(33)19-7-8-20-18-6-5-16-11-17(34)12-23(32(16,4)21(18)9-10-31(19,20)3)42-30-28(25(37)22(35)13-40-30)43-29-27(39)26(38)24(36)15(2)41-29/h5,7,15,17-18,20-30,34-39H,6,8-13H2,1-4H3/t15-,17+,18-,20-,21-,22-,23+,24-,25-,26+,27+,28+,29-,30-,31+,32-/m0/s1 |
InChI Key | UFTWXDOGUCZAHB-FPWJWPTPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H48O11 |
Molecular Weight | 608.70 g/mol |
Exact Mass | 608.31966234 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of 1-[(1R,3R,8S,9S,10R,13S,14S)-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone 2D Structure of 1-[(1R,3R,8S,9S,10R,13S,14S)-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone](https://plantaedb.com/storage/docs/compounds/2023/11/82c27170-8708-11ee-9df8-39a4f4371152.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.92% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.78% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.29% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.60% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.35% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.13% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.62% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.59% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.27% | 95.89% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.38% | 97.53% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.40% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.94% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.81% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.27% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.89% | 97.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.63% | 89.05% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.47% | 85.31% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.61% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dracaena angustifolia |
Ruscus aculeatus |
PubChem | 101131627 |
LOTUS | LTS0113809 |
wikiData | Q105272107 |