methyl (1R,2R,3S,3aR,8bS)-1-acetyloxy-3a-(1,3-benzodioxol-5-yl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate
Internal ID | 589b0406-df51-401a-a7c6-ffff305e8c52 |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Flavaglines |
IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1-acetyloxy-3a-(1,3-benzodioxol-5-yl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
SMILES (Canonical) | CC(=O)OC1C(C(C2(C1(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@@H]([C@H]([C@]2([C@@]1(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC |
InChI | InChI=1S/C30H28O10/c1-16(31)39-27-24(28(32)36-4)25(17-8-6-5-7-9-17)30(18-10-11-20-21(12-18)38-15-37-20)29(27,33)26-22(35-3)13-19(34-2)14-23(26)40-30/h5-14,24-25,27,33H,15H2,1-4H3/t24-,25-,27-,29+,30+/m1/s1 |
InChI Key | LKTVHWYLAFQHAX-KKPOPCGDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H28O10 |
Molecular Weight | 548.50 g/mol |
Exact Mass | 548.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of methyl (1R,2R,3S,3aR,8bS)-1-acetyloxy-3a-(1,3-benzodioxol-5-yl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate 2D Structure of methyl (1R,2R,3S,3aR,8bS)-1-acetyloxy-3a-(1,3-benzodioxol-5-yl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/07/80b93880-2441-11ee-8f90-a140f96c4c59.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
CHEMBL240 | Q12809 | HERG | 96.03% | 89.76% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.15% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.83% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.71% | 94.45% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 93.16% | 89.44% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.79% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.53% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.85% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.82% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.74% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.69% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 88.47% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.57% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.39% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.39% | 96.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.63% | 96.77% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.04% | 94.80% |
CHEMBL5028 | O14672 | ADAM10 | 83.38% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.54% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.43% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.74% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia spectabilis |
Ammodendron karelinii |
Citrus japonica |
Duguetia chrysocarpa |
Phaseolus coccineus |
Pinus yunnanensis |
Sicyos edulis |
PubChem | 10697870 |
NPASS | NPC136275 |
LOTUS | LTS0107610 |
wikiData | Q105153279 |