8-Isopropyl-2,5-dimethyl-1,2,3,4-tetrahydronaphthalene
| Internal ID | d301dbc2-b765-4d0e-a50f-ddaf3b8eed93 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2,5-dimethyl-8-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES (Canonical) | CC1CCC2=C(C=CC(=C2C1)C(C)C)C |
| SMILES (Isomeric) | CC1CCC2=C(C=CC(=C2C1)C(C)C)C |
| InChI | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,8,10-11H,5,7,9H2,1-4H3 |
| InChI Key | LVIDDMJSLAVTSZ-UHFFFAOYSA-N |
| Popularity | 15 references in papers |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.172150702 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.00 |
| Calamene |
| 8-Isopropyl-2,5-dimethyl-1,2,3,4-tetrahydronaphthalene |
| 1460-96-4 |
| 8-Isopropyl-2,5-dimethyltetralin |
| 1406-50-4 |
| 2,5-dimethyl-8-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| 5,6,7,8-tetrahydrocadalene |
| DTXSID30930881 |
| LVIDDMJSLAVTSZ-UHFFFAOYSA-N |
| 8-Isopropyl-2,5-dimethyl-1,2,3,4-tetrahydronaphthalene # |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.96% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.82% | 93.56% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 90.63% | 86.00% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 88.78% | 91.65% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.96% | 97.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.45% | 95.56% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.06% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.85% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.82% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.47% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.94% | 96.47% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 81.66% | 95.34% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.54% | 89.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.74% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.44% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.22% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma kwangsiensis |
| Curcuma phaeocaulis |
| Curcuma wenyujin |
| Curcuma zedoaria |
| Larix lyallii |
| Origanum dictamnus |
| Origanum majorana |
| Packera tomentosa |
| Salvia fruticosa |
| PubChem | 518975 |
| NPASS | NPC115441 |
| LOTUS | LTS0255273 |
| wikiData | Q75069751 |