8-Hydroxypinoresinol-acetat
Internal ID | 476cc356-0d67-4f9f-89b8-87c3f592c59c |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | [(3R,3aS,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
SMILES (Canonical) | CC(=O)OC12COC(C1COC2C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)C5=CC(=C(C=C5)O)OC |
SMILES (Isomeric) | CC(=O)O[C@]12CO[C@@H]([C@H]1CO[C@@H]2C3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)C5=CC(=C(C=C5)O)OC |
InChI | InChI=1S/C28H34O13/c1-13(30)41-28-12-38-25(14-4-6-17(31)19(8-14)35-2)16(28)11-37-26(28)15-5-7-18(20(9-15)36-3)39-27-24(34)23(33)22(32)21(10-29)40-27/h4-9,16,21-27,29,31-34H,10-12H2,1-3H3/t16-,21-,22-,23+,24-,25-,26-,27-,28-/m1/s1 |
InChI Key | ARPKCZZZMDEOIF-FTCJPABESA-N |
Popularity | 3 references in papers |
Molecular Formula | C28H34O13 |
Molecular Weight | 578.60 g/mol |
Exact Mass | 578.19994113 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 0.00 |
AKOS040739657 |
NCGC00380166-01 |
NCGC00380166-01_C28H34O13_beta-D-Glucopyranoside, 4-[(1R,3aR,4S,6aS)-6a-(acetyloxy)tetrahydro-4-(4-hydroxy-3-methoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]-2-methoxyphenyl |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.56% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.80% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.54% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.38% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.05% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.79% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.84% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.54% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.84% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.06% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.37% | 97.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.03% | 91.49% |
CHEMBL5028 | O14672 | ADAM10 | 81.65% | 97.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.82% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.71% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.31% | 90.00% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.19% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Olea europaea |
Olea europaea subsp. cuspidata |
PubChem | 14756310 |
LOTUS | LTS0084219 |
wikiData | Q104917496 |