7,9-Dihydroxy-3,10-dimethyl-6-methylidene-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one
Internal ID | caf896e3-d2c3-4924-8e15-3079e8445d9b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 7,9-dihydroxy-3,10-dimethyl-6-methylidene-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one |
SMILES (Canonical) | CC1C2CCC(=C)C(CC(C(=CC2OC1=O)C)O)O |
SMILES (Isomeric) | CC1C2CCC(=C)C(CC(C(=CC2OC1=O)C)O)O |
InChI | InChI=1S/C15H22O4/c1-8-4-5-11-10(3)15(18)19-14(11)6-9(2)13(17)7-12(8)16/h6,10-14,16-17H,1,4-5,7H2,2-3H3 |
InChI Key | LLPYDSMSNNUQCD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O4 |
Molecular Weight | 266.33 g/mol |
Exact Mass | 266.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.44% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.79% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.45% | 91.49% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.75% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.17% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.15% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.72% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.58% | 89.00% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 84.56% | 91.76% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.24% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.46% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.34% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia arborescens |
Artemisia pontica |
Chrysanthemum lavandulifolium |
Seriphidium fragrans |
Tanacetum sinaicum |
PubChem | 73825126 |
LOTUS | LTS0089064 |
wikiData | Q105153649 |