(2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,13,15,23-tetrol
Internal ID | a5ccd31a-903b-4689-bb30-86f533e9179c |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,13,15,23-tetrol |
SMILES (Canonical) | C1=CC(=CC=C1C2C3C(C(C4=C(C=C(C=C4O)O)C5C(OC6=CC(=CC3=C56)O)C7=CC=C(C=C7)O)C8=CC=C(C=C8)O)C9=C2C(=CC(=C9)OC1C(C(C(C(O1)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@H]3[C@@H]([C@H](C4=C(C=C(C=C4O)O)[C@@H]5[C@H](OC6=CC(=CC3=C56)O)C7=CC=C(C=C7)O)C8=CC=C(C=C8)O)C9=C2C(=CC(=C9)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)O |
InChI | InChI=1S/C48H42O14/c49-19-35-44(57)45(58)46(59)48(62-35)60-28-17-31-39(33(56)18-28)37(21-3-9-24(51)10-4-21)41-30-14-27(54)16-34-40(30)43(47(61-34)22-5-11-25(52)12-6-22)29-13-26(53)15-32(55)38(29)36(42(31)41)20-1-7-23(50)8-2-20/h1-18,35-37,41-59H,19H2/t35-,36+,37-,41+,42-,43+,44-,45+,46-,47-,48-/m1/s1 |
InChI Key | BSNDXZQSVIPQKG-FSWJRTEZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H42O14 |
Molecular Weight | 842.80 g/mol |
Exact Mass | 842.25745601 g/mol |
Topological Polar Surface Area (TPSA) | 250.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
![2D Structure of (2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,13,15,23-tetrol 2D Structure of (2R,3R,10S,11S,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,13,15,23-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/78cab250-8728-11ee-a6f1-81ba6a1f1b99.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.24% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.79% | 99.15% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.29% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.96% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.68% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.54% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.29% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.58% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.48% | 94.73% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.17% | 97.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.69% | 95.78% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.12% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.87% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.22% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.52% | 85.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.02% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonurus glaucescens |
Marrubium velutinum |
Stachys byzantina |
Vatica pauciflora |
PubChem | 21674277 |
LOTUS | LTS0209938 |
wikiData | Q82906136 |