7-Isopentenyloxy-gamma-fagarine
| Internal ID | 4acb3af7-f973-49ee-9a71-ad5929a151f5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 4,8-dimethoxy-7-(3-methylbut-2-enoxy)furo[2,3-b]quinoline |
| SMILES (Canonical) | CC(=CCOC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)C |
| SMILES (Isomeric) | CC(=CCOC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)C |
| InChI | InChI=1S/C18H19NO4/c1-11(2)7-9-22-14-6-5-12-15(17(14)21-4)19-18-13(8-10-23-18)16(12)20-3/h5-8,10H,9H2,1-4H3 |
| InChI Key | HEMHXTACMCBNFZ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 53.70 Ų |
| XlogP | 4.30 |
| 23417-92-7 |
| 7-O-Isopentenyl-|A-fagarine |
| 4,8-dimethoxy-7-(3-methylbut-2-enoxy)furo[2,3-b]quinoline |
| 7-O-Isopentenyl-gamma-fagarine |
| 7-Prenyloxy-gamma-Fagarine |
| Furo[2,3-b]quinoline, 4,8-dimethoxy-7-[(3-methyl-2-butenyl)oxy]- ; 4,8-Dimethoxy-7-[(3-methyl-2-buten-1-yl)oxy]furo[2,3-b]quinoline; 7-(Isopentenyloxy)-gamma-fagarine; 7-Isopenthyloxy-gamma-fagarine |
| 7-O-Isopentenyl--fagarine |
| HY-N2759 |
| AKOS032962281 |
| FS-9634 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.23% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.35% | 96.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.38% | 95.12% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.40% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.32% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 87.42% | 94.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.04% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.33% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.27% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.67% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.92% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.85% | 99.23% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.04% | 96.67% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.79% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Choisya ternata |
| Ertela trifolia |
| Haplophyllum acutifolium |
| Haplophyllum ferganicum |
| Peltostigma guatemalense |
| Ptelea aptera |
| Vepris gerrardii |
| Vepris nobilis |
| PubChem | 12110169 |
| LOTUS | LTS0071567 |
| wikiData | Q105026909 |