7-Hydroxyflavone
| Internal ID | 0e223b20-e089-4285-997e-91a9ef826337 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 7-hydroxy-2-phenylchromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H10O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-9,16H |
| InChI Key | MQGPSCMMNJKMHQ-UHFFFAOYSA-N |
| Popularity | 311 references in papers |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.60 |
| Atomic LogP (AlogP) | 3.17 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 1 |
| 6665-86-7 |
| 7-Hydroxy-2-phenyl-4H-chromen-4-one |
| 7-hydroxy-2-phenylchromen-4-one |
| 4H-1-Benzopyran-4-one, 7-hydroxy-2-phenyl- |
| 7-Hydroxy-2-phenyl-4-benzopyrone |
| 7-Hydroxy-2-phenyl-chromen-4-one |
| NSC-94258 |
| 7-hydroxy flavone |
| CHEBI:2268 |
| ZE72458E4L |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9964 | 99.64% |
| Caco-2 | - | 0.8704 | 87.04% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | + | 0.5857 | 58.57% |
| Subcellular localzation | Mitochondria | 0.6768 | 67.68% |
| OATP2B1 inhibitior | - | 0.7273 | 72.73% |
| OATP1B1 inhibitior | + | 0.9148 | 91.48% |
| OATP1B3 inhibitior | + | 0.9917 | 99.17% |
| MATE1 inhibitior | - | 0.7600 | 76.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.7045 | 70.45% |
| P-glycoprotein inhibitior | - | 0.7514 | 75.14% |
| P-glycoprotein substrate | - | 0.8852 | 88.52% |
| CYP3A4 substrate | - | 0.5808 | 58.08% |
| CYP2C9 substrate | - | 0.8209 | 82.09% |
| CYP2D6 substrate | - | 0.8000 | 80.00% |
| CYP3A4 inhibition | - | 0.5182 | 51.82% |
| CYP2C9 inhibition | + | 0.6033 | 60.33% |
| CYP2C19 inhibition | + | 0.7571 | 75.71% |
| CYP2D6 inhibition | - | 0.9470 | 94.70% |
| CYP1A2 inhibition | + | 0.9393 | 93.93% |
| CYP2C8 inhibition | + | 0.6675 | 66.75% |
| CYP inhibitory promiscuity | - | 0.6097 | 60.97% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.9313 | 93.13% |
| Carcinogenicity (trinary) | Non-required | 0.4605 | 46.05% |
| Eye corrosion | - | 0.9635 | 96.35% |
| Eye irritation | + | 0.9783 | 97.83% |
| Skin irritation | + | 0.7177 | 71.77% |
| Skin corrosion | - | 0.9915 | 99.15% |
| Ames mutagenesis | - | 0.7700 | 77.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.8427 | 84.27% |
| Micronuclear | + | 0.7559 | 75.59% |
| Hepatotoxicity | + | 0.5825 | 58.25% |
| skin sensitisation | - | 0.8710 | 87.10% |
| Respiratory toxicity | + | 0.5444 | 54.44% |
| Reproductive toxicity | + | 0.6889 | 68.89% |
| Mitochondrial toxicity | - | 0.5750 | 57.50% |
| Nephrotoxicity | - | 0.6400 | 64.00% |
| Acute Oral Toxicity (c) | III | 0.6941 | 69.41% |
| Estrogen receptor binding | + | 0.9548 | 95.48% |
| Androgen receptor binding | + | 0.9536 | 95.36% |
| Thyroid receptor binding | + | 0.6776 | 67.76% |
| Glucocorticoid receptor binding | + | 0.9458 | 94.58% |
| Aromatase binding | + | 0.9574 | 95.74% |
| PPAR gamma | + | 0.9055 | 90.55% |
| Honey bee toxicity | - | 0.8662 | 86.62% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.8148 | 81.48% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL5983 | O60218 | Aldo-keto reductase family 1 member B10 |
8300 nM 160000 nM |
IC50 IC50 |
PMID: 26529431
PMID: 26529431 |
| CHEMBL1900 | P15121 | Aldose reductase |
12300 nM |
IC50 |
PMID: 26529431
|
| CHEMBL261 | P00915 | Carbonic anhydrase I |
3370 nM 3430 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
| CHEMBL205 | P00918 | Carbonic anhydrase II |
2240 nM 2320 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
| CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
4850 nM 4920 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
| CHEMBL3242 | O43570 | Carbonic anhydrase XII |
8400 nM 8510 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
30.5 nM 30.5 nM |
IC50 IC50 |
PMID: 20413308
via Super-PRED |
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
240 nM |
IC50 |
PMID: 20832301
|
| CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
250 nM |
IC50 |
via Super-PRED
|
| CHEMBL3181 | P14061 | Estradiol 17-beta-dehydrogenase 1 |
5250 nM |
IC50 |
PMID: 18533708
|
| CHEMBL1929 | P47989 | Xanthine dehydrogenase |
38000 nM |
IC50 |
PMID: 9461655
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.61% | 91.11% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 95.34% | 83.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.14% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.20% | 89.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.81% | 98.35% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.62% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.23% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.59% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.20% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.18% | 85.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.16% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.85% | 94.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.73% | 92.08% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.02% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus microcephalus |
| Berberis dictyota |
| Jasminum sambac |
| Lawsonia inermis |
| Muntingia calabura |
| PubChem | 5281894 |
| NPASS | NPC57601 |
| ChEMBL | CHEMBL276915 |
| LOTUS | LTS0135437 |
| wikiData | Q27105601 |