6beta-Hydroxyipolamiide
Internal ID | 25099fd7-b549-4127-87ff-ba7fe21a711b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aR,5R,7S,7aR)-4a,5,7-trihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(CC(C2(C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@]1(C[C@H]([C@]2([C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
InChI | InChI=1S/C17H26O12/c1-16(24)3-8(19)17(25)6(13(23)26-2)5-27-15(12(16)17)29-14-11(22)10(21)9(20)7(4-18)28-14/h5,7-12,14-15,18-22,24-25H,3-4H2,1-2H3/t7-,8-,9-,10+,11-,12-,14+,15+,16+,17-/m1/s1 |
InChI Key | RRKJSAASNMDKLI-NZHINYMZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O12 |
Molecular Weight | 422.40 g/mol |
Exact Mass | 422.14242626 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | -3.10 |
87797-84-0 |
methyl (1S,4aR,5R,7S,7aR)-4a,5,7-trihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
6-Hydroxyipolamiide |
MEGxp0_001330 |
ACon1_001407 |
AKOS032962241 |
FS-9125 |
NCGC00180538-01 |
BRD-K69634923-001-01-1 |
Cyclopenta[c]pyran-4-carboxylic acid, 1-(-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,5,7-trihydroxy-7-methyl-, methyl ester, [1S-(1,4a,5,7,7a)]- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.74% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.66% | 91.11% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.92% | 91.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.09% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.40% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.98% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.62% | 94.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.36% | 96.61% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.00% | 96.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.54% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.53% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 81.09% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lamium amplexicaule |
Phlomis rigida |
Stachytarpheta mutabilis |
PubChem | 14137128 |
LOTUS | LTS0083019 |
wikiData | Q105244161 |