[(2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate
Internal ID | 1b95b0d3-d9c9-478d-bebc-54cbaa308fb7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)C3C(C(OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)C6=CC(=C(C=C6)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@@H]3[C@H]([C@H](OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)C6=CC(=C(C=C6)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
InChI | InChI=1S/C37H30O16/c38-16-9-22(43)29-27(10-16)52-36(14-2-4-19(40)21(42)6-14)34(49)31(29)30-23(44)12-26-17(32(30)47)11-28(35(51-26)13-1-3-18(39)20(41)5-13)53-37(50)15-7-24(45)33(48)25(46)8-15/h1-10,12,28,31,34-36,38-49H,11H2/t28-,31-,34-,35-,36-/m1/s1 |
InChI Key | DWTOBCBYINHWCP-DQUMCVOZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H30O16 |
Molecular Weight | 730.60 g/mol |
Exact Mass | 730.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 288.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of [(2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate 2D Structure of [(2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/69d439a0-853a-11ee-a2fe-e59ffc36c932.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.64% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 95.38% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.92% | 96.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.93% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.34% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 91.12% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.39% | 89.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 89.75% | 96.37% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.44% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.40% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.13% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.86% | 99.23% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.25% | 97.53% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.65% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.20% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 84.19% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.14% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.58% | 95.56% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.54% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rumex acetosa |
Vitis amurensis |
PubChem | 102005056 |
LOTUS | LTS0160903 |
wikiData | Q104990738 |