(2S,3S,8R,9S,10R,13R,14S,16S)-17-[(E,1R)-1,5-dihydroxy-1,5-dimethyl-2-oxo-hex-3-enyl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-11,15-dione
Internal ID | b458e312-16f4-4bf1-bfd8-899caf447ac8 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (2S,3S,8R,9S,10R,13R,14S,16S)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-11,15-dione |
SMILES (Canonical) | CC1(C(C(CC2C1=CCC3C2(C(=O)CC4(C3(C(=O)C(C4C(C)(C(=O)C=CC(C)(C)O)O)O)C)C)C)O)O)C |
SMILES (Isomeric) | C[C@]12CC(=O)[C@@]3([C@H]([C@@]1(C(=O)[C@H](C2[C@](C)(C(=O)/C=C/C(C)(C)O)O)O)C)CC=C4[C@H]3C[C@@H]([C@H](C4(C)C)O)O)C |
InChI | InChI=1S/C30H44O8/c1-25(2,37)12-11-19(32)30(8,38)22-21(34)24(36)29(7)18-10-9-15-16(13-17(31)23(35)26(15,3)4)28(18,6)20(33)14-27(22,29)5/h9,11-12,16-18,21-23,31,34-35,37-38H,10,13-14H2,1-8H3/b12-11+/t16-,17+,18-,21+,22?,23-,27-,28+,29-,30+/m1/s1 |
InChI Key | UGRYXCKXFRMPOI-VYDLIQPASA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H44O8 |
Molecular Weight | 532.70 g/mol |
Exact Mass | 532.30361836 g/mol |
Topological Polar Surface Area (TPSA) | 152.00 Ų |
XlogP | 1.10 |
CHEMBL283616 |
(2S,3S,8R,9S,10R,13R,14S,16S)-17-[(E,1R)-1,5-dihydroxy-1,5-dimethyl-2-oxo-hex-3-enyl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-2,3,7,8,10,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-11,15-dione |
9-Methyl-2,3,16,20,25-pentahydroxy-19-norlanosta-5,23-diene-11,15,22-trione, (2.beta.,3.alpha.,9.beta.,10.alpha.,23E) |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.31% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.50% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.20% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.11% | 96.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.33% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.05% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.02% | 86.33% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.14% | 97.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.81% | 96.77% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.75% | 91.07% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.50% | 98.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.37% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.61% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.37% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crataegus pinnatifida |
Olea europaea |
Purshia mexicana |
PubChem | 6473862 |
LOTUS | LTS0202490 |
wikiData | Q104393312 |