[17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | b0de2461-efcf-440d-821e-e9f7fdf20b4f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)OC(=O)C)C)C)C(C)C |
SMILES (Isomeric) | CCC(C=CC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)OC(=O)C)C)C)C(C)C |
InChI | InChI=1S/C31H50O2/c1-8-23(20(2)3)10-9-21(4)27-13-14-28-26-12-11-24-19-25(33-22(5)32)15-17-30(24,6)29(26)16-18-31(27,28)7/h9-10,12,20-21,23-25,27-29H,8,11,13-19H2,1-7H3 |
InChI Key | VQLULFBGTFJDEB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O2 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 8.90 |
There are no found synonyms. |
![2D Structure of [17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate 2D Structure of [17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/652c57e0-865f-11ee-bcce-9f18975a1c68.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.13% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.28% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.27% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.98% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.09% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.39% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.80% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.75% | 98.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.12% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.85% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.11% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.15% | 95.71% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.76% | 96.38% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.52% | 98.75% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.35% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.30% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.23% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.10% | 91.19% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.09% | 97.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.91% | 92.62% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.75% | 92.86% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.66% | 96.95% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.61% | 97.53% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.55% | 94.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.14% | 89.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.14% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baccharoides anthelmintica |
Cucurbita pepo |
Trichosanthes ovigera |
PubChem | 347368 |
LOTUS | LTS0108564 |
wikiData | Q105291362 |