(1S,2S,4S,6R,7S,8R,9S,12S,13S,14R,16S,17S,18R)-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-18-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-14,16,17-triol
Internal ID | 5b16b99e-2cc1-4e2f-a0b3-8f6149235068 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1S,2S,4S,6R,7S,8R,9S,12S,13S,14R,16S,17S,18R)-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-18-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-14,16,17-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5(C4(C(CC(C5O)O)O)C)OC6C(C(C(C(O6)CO)O)O)O)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@]5([C@@]4([C@@H](C[C@@H]([C@@H]5O)O)O)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)O[C@@]1(CC[C@H](C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)OC |
InChI | InChI=1S/C40H68O17/c1-17(16-53-35-32(49)30(47)28(45)24(14-41)54-35)6-11-40(52-5)18(2)27-23(56-40)12-21-19-7-10-39(57-36-33(50)31(48)29(46)25(15-42)55-36)34(51)22(43)13-26(44)38(39,4)20(19)8-9-37(21,27)3/h17-36,41-51H,6-16H2,1-5H3/t17-,18-,19+,20-,21-,22-,23-,24+,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35+,36-,37-,38-,39-,40+/m0/s1 |
InChI Key | PRZNANCAPPAZGV-NDKFKRRVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H68O17 |
Molecular Weight | 821.00 g/mol |
Exact Mass | 820.44565070 g/mol |
Topological Polar Surface Area (TPSA) | 278.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.43% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.90% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.25% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.67% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.36% | 98.10% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 89.39% | 92.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.13% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.79% | 92.86% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.16% | 97.79% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.32% | 96.43% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.87% | 93.18% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.41% | 96.61% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.64% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.48% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.99% | 95.89% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 83.24% | 87.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.83% | 94.75% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.62% | 89.05% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.28% | 97.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.87% | 100.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.26% | 92.78% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.86% | 98.05% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.82% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.50% | 97.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.32% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aspidistra elatior |
Jatropha curcas |
Jatropha multifida |
PubChem | 162871367 |
LOTUS | LTS0222092 |
wikiData | Q105249227 |