[6-Methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] thiocyanate
| Internal ID | 1e4e72ce-b1d7-46ed-b87c-b0071be83960 |
| IUPAC Name | [6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] thiocyanate |
| SMILES (Canonical) | CC1=CCC(CC1)C(C)(CCC=C(C)C)SC#N |
| SMILES (Isomeric) | CC1=CCC(CC1)C(C)(CCC=C(C)C)SC#N |
| InChI | InChI=1S/C16H25NS/c1-13(2)6-5-11-16(4,18-12-17)15-9-7-14(3)8-10-15/h6-7,15H,5,8-11H2,1-4H3 |
| InChI Key | HVGZCCDETWAGDK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.17077098 g/mol |
| Topological Polar Surface Area (TPSA) | 49.10 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
![2D Structure of [6-Methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] thiocyanate](https://plantaedb.com/storage/docs/compounds/2023/11/6-methyl-2-4-methylcyclohex-3-en-1-ylhept-5-en-2-yl-thiocyanate.jpg "2D Structure of [6-Methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] thiocyanate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.70% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 93.46% | 96.43% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.11% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.08% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.08% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.11% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.21% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.59% | 94.73% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.98% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.66% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.30% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.30% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.12% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anemarrhena asphodeloides |
| Broussonetia papyrifera |
| PubChem | 25179926 |
| LOTUS | LTS0181068 |
| wikiData | Q104401113 |