6-Chlorocatechin
Internal ID | 5b874203-bfa2-4d12-b092-4399b698aaa6 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins |
IUPAC Name | 6-chloro-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)Cl)O)C3=CC(=C(C=C3)O)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=C(C(=C2)O)Cl)O)C3=CC(=C(C=C3)O)O)O |
InChI | InChI=1S/C15H13ClO6/c16-13-10(19)5-12-7(14(13)21)4-11(20)15(22-12)6-1-2-8(17)9(18)3-6/h1-3,5,11,15,17-21H,4H2 |
InChI Key | BHTBHJNGFQRAJI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H13ClO6 |
Molecular Weight | 324.71 g/mol |
Exact Mass | 324.0400658 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.00 |
CHEBI:178306 |
6-Chloro-3',4',5,7-tetrahydroxyflavanol |
6-chloro-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
6-chloro-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol |
6-Chloro-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol, 9CI |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.11% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.55% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.75% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.38% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.99% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.84% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.33% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 83.56% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.19% | 86.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.72% | 100.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.33% | 96.37% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.79% | 89.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 80.72% | 95.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Geranium pratense |
Rumex patientia |
PubChem | 22297292 |
LOTUS | LTS0085842 |
wikiData | Q104936223 |