5E-7-oxozeaenol
Internal ID | 569b5486-9177-4582-8911-a776e0c49154 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues > Zearalenones |
IUPAC Name | (4S,6E,9S,10S,12E)-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
SMILES (Canonical) | CC1CC=CC(=O)C(C(CC=CC2=C(C(=CC(=C2)OC)O)C(=O)O1)O)O |
SMILES (Isomeric) | C[C@H]1C/C=C/C(=O)[C@H]([C@H](C/C=C/C2=C(C(=CC(=C2)OC)O)C(=O)O1)O)O |
InChI | InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3+/t11-,15-,18+/m0/s1 |
InChI Key | NEQZWEXWOFPKOT-ULSULSEOSA-N |
Popularity | 22 references in papers |
Molecular Formula | C19H22O7 |
Molecular Weight | 362.40 g/mol |
Exact Mass | 362.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 1.60 |
H-Bond Acceptor | 7 |
H-Bond Donor | 3 |
Rotatable Bonds | 1 |
(5E)-7-Oxozeaenol |
CHEBI:67558 |
CHEMBL1801950 |
(5Z)-7-Oxozeaenol |
Cochliomycin F |
LL-Z-1640-2 |
(4S,6E,9S,10S,12E)-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
253863-19-3 |
SCHEMBL3841564 |
SCHEMBL18290352 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9620 | 96.20% |
Caco-2 | - | 0.6836 | 68.36% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.5179 | 51.79% |
OATP2B1 inhibitior | - | 0.5883 | 58.83% |
OATP1B1 inhibitior | + | 0.8996 | 89.96% |
OATP1B3 inhibitior | + | 0.9547 | 95.47% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | - | 0.4553 | 45.53% |
P-glycoprotein inhibitior | - | 0.7104 | 71.04% |
P-glycoprotein substrate | - | 0.8889 | 88.89% |
CYP3A4 substrate | + | 0.6075 | 60.75% |
CYP2C9 substrate | - | 0.8032 | 80.32% |
CYP2D6 substrate | - | 0.8578 | 85.78% |
CYP3A4 inhibition | - | 0.8181 | 81.81% |
CYP2C9 inhibition | - | 0.9444 | 94.44% |
CYP2C19 inhibition | - | 0.9238 | 92.38% |
CYP2D6 inhibition | - | 0.9243 | 92.43% |
CYP1A2 inhibition | - | 0.7269 | 72.69% |
CYP2C8 inhibition | - | 0.7862 | 78.62% |
CYP inhibitory promiscuity | - | 0.9803 | 98.03% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9443 | 94.43% |
Carcinogenicity (trinary) | Non-required | 0.5798 | 57.98% |
Eye corrosion | - | 0.9714 | 97.14% |
Eye irritation | - | 0.9400 | 94.00% |
Skin irritation | - | 0.6883 | 68.83% |
Skin corrosion | - | 0.9207 | 92.07% |
Ames mutagenesis | - | 0.5800 | 58.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5000 | 50.00% |
Micronuclear | + | 0.7000 | 70.00% |
Hepatotoxicity | - | 0.5004 | 50.04% |
skin sensitisation | - | 0.7288 | 72.88% |
Respiratory toxicity | + | 0.6889 | 68.89% |
Reproductive toxicity | + | 0.8222 | 82.22% |
Mitochondrial toxicity | + | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.5996 | 59.96% |
Acute Oral Toxicity (c) | III | 0.3904 | 39.04% |
Estrogen receptor binding | + | 0.7951 | 79.51% |
Androgen receptor binding | + | 0.6691 | 66.91% |
Thyroid receptor binding | - | 0.6766 | 67.66% |
Glucocorticoid receptor binding | + | 0.7581 | 75.81% |
Aromatase binding | + | 0.5503 | 55.03% |
PPAR gamma | + | 0.6137 | 61.37% |
Honey bee toxicity | - | 0.8722 | 87.22% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9438 | 94.38% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3587 | Q02750 | Dual specificity mitogen-activated protein kinase kinase 1 |
2.9 nM 2 nM |
IC50 IC50 |
via Super-PRED
via Super-PRED |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
738 nM |
IC50 |
via Super-PRED
|
CHEMBL5776 | O43318 | Mitogen-activated protein kinase kinase kinase 7 |
1300 nM 5.6 nM |
IC50 IC50 |
PMID: 26481152
via Super-PRED |
CHEMBL5533 | Q04206 | Nuclear factor NF-kappa-B p65 subunit |
11500 nM 250 nM |
IC50 IC50 |
PMID: 21513293
via Super-PRED |
CHEMBL6114 | Q9Y263 | Phospholipase A-2-activating protein |
11 nM |
IC50 |
via Super-PRED
|
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha |
0.24 nM |
IC50 |
via Super-PRED
|
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta |
41 nM |
IC50 |
via Super-PRED
|
CHEMBL1936 | P10721 | Stem cell growth factor receptor |
9.6 nM |
IC50 |
via Super-PRED
|
CHEMBL3038499 | Q15750 | TAK1/TAB1 |
9 nM |
IC50 |
via Super-PRED
|
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 |
4.9 nM |
IC50 |
via Super-PRED
|
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 |
12 nM |
IC50 |
via Super-PRED
|
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 |
0.49 nM |
IC50 |
via Super-PRED
|
CHEMBL1955 | P35916 | Vascular endothelial growth factor receptor 3 |
0.5 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.18% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.83% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.73% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.08% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.04% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.86% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.31% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.88% | 90.00% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 87.84% | 80.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.27% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.17% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.89% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 85.71% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.33% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.93% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.81% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.35% | 94.45% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.28% | 82.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.86% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.47% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.29% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.13% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.13% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.64% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curcuma aromatica |
Lilium lancifolium |
PubChem | 9799061 |
NPASS | NPC215711 |
ChEMBL | CHEMBL1801950 |
LOTUS | LTS0145149 |
wikiData | Q27136023 |