(10,12,14,16,22,23-Hexahydroxy-6,10,19-trimethyl-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl) 2-methylbutanoate
Internal ID | 39b2c2b3-13e1-4225-8f41-8b3caee92b28 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | (10,12,14,16,22,23-hexahydroxy-6,10,19-trimethyl-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl) 2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)O)O)C)O)O)O |
SMILES (Isomeric) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)O)O)C)O)O)O |
InChI | InChI=1S/C32H51NO9/c1-6-16(3)27(37)41-26-24(36)23-17(14-33-13-15(2)7-8-21(33)29(23,5)38)18-12-30-25(31(18,26)39)19(34)11-20-28(30,4)10-9-22(35)32(20,40)42-30/h15-26,34-36,38-40H,6-14H2,1-5H3 |
InChI Key | MVWBBTKAXTUNEE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H51NO9 |
Molecular Weight | 593.70 g/mol |
Exact Mass | 593.35638220 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of (10,12,14,16,22,23-Hexahydroxy-6,10,19-trimethyl-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl) 2-methylbutanoate 2D Structure of (10,12,14,16,22,23-Hexahydroxy-6,10,19-trimethyl-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl) 2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/5335af00-874e-11ee-b2a7-0583923b9170.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.41% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.19% | 96.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 97.27% | 89.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.10% | 96.77% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.90% | 95.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.80% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.62% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.71% | 82.69% |
CHEMBL299 | P17252 | Protein kinase C alpha | 91.58% | 98.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.72% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.68% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.37% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.03% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.49% | 86.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 89.44% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.40% | 100.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.98% | 95.36% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.96% | 90.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.92% | 97.14% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.66% | 96.47% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.42% | 99.17% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.24% | 82.50% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 85.84% | 98.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.85% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.60% | 92.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.91% | 97.28% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.74% | 95.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.36% | 96.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.31% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.78% | 97.50% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.53% | 92.86% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.05% | 89.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.58% | 95.89% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.32% | 96.90% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.28% | 90.17% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.20% | 96.61% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.19% | 100.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.12% | 100.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.94% | 90.24% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 80.55% | 95.27% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.45% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum lobelianum |
Veratrum nigrum |
PubChem | 75094366 |
LOTUS | LTS0072039 |
wikiData | Q105173378 |