5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium
| Internal ID | 8fcaa715-d77d-40a0-9a63-5f24b025faa1 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium |
| SMILES (Canonical) | CC1=C2C=C[NH+]=CC2=C(C3=C1NC4=CC=CC=C43)C |
| SMILES (Isomeric) | CC1=C2C=C[NH+]=CC2=C(C3=C1NC4=CC=CC=C43)C |
| InChI | InChI=1S/C17H14N2/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17/h3-9,19H,1-2H3/p+1 |
| InChI Key | CTSPAMFJBXKSOY-UHFFFAOYSA-O |
| Popularity | 2 references in papers |
| Molecular Formula | C17H15N2+ |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.123523487 g/mol |
| Topological Polar Surface Area (TPSA) | 29.90 Ų |
| XlogP | 5.00 |
| Q63390513 |
![2D Structure of 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium](https://plantaedb.com/storage/docs/compounds/2023/07/511-dimethyl-2-azonia-6h-pyrido43-bcarbazole.jpg "2D Structure of 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 96.33% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.10% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.63% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.21% | 91.11% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.62% | 88.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.62% | 94.73% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.27% | 93.99% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.70% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.84% | 94.45% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.45% | 93.81% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.26% | 100.00% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 80.09% | 81.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.03% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aspidosperma subincanum |
| Corymbia citriodora |
| Euphorbia hirta |
| Geranium sibiricum |
| Lythrum salicaria |
| Mangifera indica |
| Platycarya strobilacea |
| Terminalia chebula |