5-Methoxytryptamine
Internal ID | 273b6a1f-d780-418e-8699-8bfebcef672c |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Tryptamines and derivatives |
IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)ethanamine |
SMILES (Canonical) | COC1=CC2=C(C=C1)NC=C2CCN |
SMILES (Isomeric) | COC1=CC2=C(C=C1)NC=C2CCN |
InChI | InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
InChI Key | JTEJPPKMYBDEMY-UHFFFAOYSA-N |
Popularity | 1,629 references in papers |
Molecular Formula | C11H14N2O |
Molecular Weight | 190.24 g/mol |
Exact Mass | 190.110613074 g/mol |
Topological Polar Surface Area (TPSA) | 51.00 Ų |
XlogP | 0.50 |
Atomic LogP (AlogP) | 1.68 |
H-Bond Acceptor | 2 |
H-Bond Donor | 2 |
Rotatable Bonds | 3 |
608-07-1 |
2-(5-Methoxy-1H-indol-3-yl)ethanamine |
Mexamine |
3-(2-Aminoethyl)-5-methoxyindole |
Methoxytryptamine |
O-Methylserotonin |
1H-Indole-3-ethanamine, 5-methoxy- |
Mexamine base |
5MOT |
5-Mot |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 5-Methoxytryptamine 2D Structure of 5-Methoxytryptamine](https://plantaedb.com/storage/docs/compounds/2023/11/5-methoxytryptamine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.7769 | 77.69% |
Blood Brain Barrier | + | 0.8500 | 85.00% |
Human oral bioavailability | + | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.3976 | 39.76% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9531 | 95.31% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | + | 0.6750 | 67.50% |
BSEP inhibitior | - | 0.6334 | 63.34% |
P-glycoprotein inhibitior | - | 0.9821 | 98.21% |
P-glycoprotein substrate | + | 0.5164 | 51.64% |
CYP3A4 substrate | - | 0.5832 | 58.32% |
CYP2C9 substrate | - | 0.8165 | 81.65% |
CYP2D6 substrate | + | 0.6752 | 67.52% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.5916 | 59.16% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.6902 | 69.02% |
CYP inhibitory promiscuity | + | 0.6501 | 65.01% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8900 | 89.00% |
Carcinogenicity (trinary) | Non-required | 0.6031 | 60.31% |
Eye corrosion | - | 0.9738 | 97.38% |
Eye irritation | - | 0.9016 | 90.16% |
Skin irritation | - | 0.6674 | 66.74% |
Skin corrosion | - | 0.8047 | 80.47% |
Ames mutagenesis | - | 0.7000 | 70.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3913 | 39.13% |
Micronuclear | + | 0.6000 | 60.00% |
Hepatotoxicity | - | 0.8125 | 81.25% |
skin sensitisation | - | 0.8908 | 89.08% |
Respiratory toxicity | + | 0.8111 | 81.11% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.8932 | 89.32% |
Acute Oral Toxicity (c) | III | 0.5503 | 55.03% |
Estrogen receptor binding | - | 0.5902 | 59.02% |
Androgen receptor binding | - | 0.8255 | 82.55% |
Thyroid receptor binding | - | 0.6198 | 61.98% |
Glucocorticoid receptor binding | - | 0.5422 | 54.22% |
Aromatase binding | - | 0.6897 | 68.97% |
PPAR gamma | - | 0.6614 | 66.14% |
Honey bee toxicity | - | 0.9517 | 95.17% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | - | 0.9498 | 94.98% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL224 | P28223 | Serotonin 2a (5-HT2a) receptor |
0.503 nM |
EC50 |
via Super-PRED
|
CHEMBL1875 | Q13639 | Serotonin 4 (5-HT4) receptor |
26.92 nM |
Ki |
via Super-PRED
|
CHEMBL3371 | P50406 | Serotonin 6 (5-HT6) receptor |
50 nM |
Ki |
via Super-PRED
|
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
5.012 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.03% | 96.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 94.71% | 93.18% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.26% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.87% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.48% | 97.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.40% | 90.24% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 88.18% | 82.86% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.57% | 92.62% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 87.33% | 95.48% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.15% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.92% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.88% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.72% | 98.75% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 85.37% | 95.55% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.36% | 93.31% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.25% | 98.59% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.02% | 92.94% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.89% | 91.71% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.14% | 93.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.04% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.79% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.62% | 93.99% |
CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 82.07% | 96.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.98% | 95.89% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 80.47% | 89.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinchona calisaya |
Mimosa somnians |
Virola peruviana |
PubChem | 1833 |
LOTUS | LTS0011527 |
wikiData | Q4352011 |