5-Methoxy-6-(3-methoxy-3-methylbut-1-enyl)-2,2-dimethylpyrano[2,3-h]chromen-8-one
| Internal ID | 5e797728-3396-4eaf-b0a4-a9ca0990e6cf |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Angular pyranocoumarins |
| IUPAC Name | 5-methoxy-6-(3-methoxy-3-methylbut-1-enyl)-2,2-dimethylpyrano[2,3-h]chromen-8-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C3=C(C(=C2OC)C=CC(C)(C)OC)OC(=O)C=C3)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C3=C(C(=C2OC)C=CC(C)(C)OC)OC(=O)C=C3)C |
| InChI | InChI=1S/C21H24O5/c1-20(2,24-6)11-9-14-17(23-5)15-10-12-21(3,4)26-19(15)13-7-8-16(22)25-18(13)14/h7-12H,1-6H3 |
| InChI Key | DOXLEULKLKKQAR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 5-Methoxy-6-(3-methoxy-3-methylbut-1-enyl)-2,2-dimethylpyrano[2,3-h]chromen-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-methoxy-6-3-methoxy-3-methylbut-1-enyl-22-dimethylpyrano23-hchromen-8-one.jpg "2D Structure of 5-Methoxy-6-(3-methoxy-3-methylbut-1-enyl)-2,2-dimethylpyrano[2,3-h]chromen-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.50% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.99% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.05% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.02% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.37% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.60% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.29% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.02% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.80% | 97.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.76% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.24% | 86.33% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.17% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Philotheca citrina |
| Zanthoxylum avicennae |
| PubChem | 72745418 |
| LOTUS | LTS0119812 |
| wikiData | Q104986303 |