5-methoxy-3-methyl-9H-carbazole
| Internal ID | 963c1cfe-adfe-42d3-994b-0769fab34c1e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 5-methoxy-3-methyl-9H-carbazole |
| SMILES (Canonical) | CC1=CC2=C(C=C1)NC3=C2C(=CC=C3)OC |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)NC3=C2C(=CC=C3)OC |
| InChI | InChI=1S/C14H13NO/c1-9-6-7-11-10(8-9)14-12(15-11)4-3-5-13(14)16-2/h3-8,15H,1-2H3 |
| InChI Key | BDXQUUJCBXWOJO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.099714038 g/mol |
| Topological Polar Surface Area (TPSA) | 25.00 Ų |
| XlogP | 3.70 |
| 359865-27-3 |
| C14H13NO |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2535 | P11166 | Glucose transporter | 95.74% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.06% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.01% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.60% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.10% | 96.09% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.79% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.30% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.86% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.74% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.64% | 93.31% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.48% | 89.62% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.04% | 91.71% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.84% | 90.20% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.72% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.96% | 96.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.75% | 93.18% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.91% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.72% | 97.21% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.54% | 94.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.78% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.90% | 94.75% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.19% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis macrophylla |
| Glycosmis mauritiana |
| Glycosmis pentaphylla |
| PubChem | 11148528 |
| LOTUS | LTS0193748 |
| wikiData | Q104932395 |