4H-1-Benzopyran-4-one, 3-((6-deoxy-alpha-L-mannopyranosyl)oxy)-5,7-dihydroxy-
Internal ID | 29e481bd-8ed7-4dc2-ba24-e4a77bf41ebb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | 5,7-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=COC3=CC(=CC(=C3C2=O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=COC3=CC(=CC(=C3C2=O)O)O)O)O)O |
InChI | InChI=1S/C15H16O9/c1-5-11(18)13(20)14(21)15(23-5)24-9-4-22-8-3-6(16)2-7(17)10(8)12(9)19/h2-5,11,13-18,20-21H,1H3/t5-,11-,13+,14+,15-/m0/s1 |
InChI Key | XCVOCJFOQNDTNC-ZNDRGHTASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H16O9 |
Molecular Weight | 340.28 g/mol |
Exact Mass | 340.07943208 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -0.10 |
CHEMBL470337 |
DTXSID00992714 |
4H-1-Benzopyran-4-one, 3-((6-deoxy-alpha-L-mannopyranosyl)oxy)-5,7-dihydroxy- |
5,7-Dihydroxy-4-oxo-4H-1-benzopyran-3-yl 6-deoxyhexopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.49% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.19% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.00% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.50% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.91% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.86% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.83% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 87.25% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.22% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.45% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.21% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.56% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.92% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.22% | 99.23% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.66% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astilbe thunbergii |
Cratoxylum arborescens |
Durio zibethinus |
Hymenaea martiana |
Smilax corbularia |
PubChem | 5488575 |
LOTUS | LTS0144711 |
wikiData | Q82983081 |