[(9R,10R,11S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] (Z)-2-methylbut-2-enoate
Internal ID | 14c294ef-7948-451d-8c3c-5ff5e654cfe6 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(9R,10R,11S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(CC2=CC(=C(C(=C2C3=C(C4=C(C=C13)OCO4)OC)OC)OC)OC)C)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@@H](CC2=CC(=C(C(=C2C3=C(C4=C(C=C13)OCO4)OC)OC)OC)OC)C)C |
InChI | InChI=1S/C28H34O8/c1-9-14(2)28(29)36-23-16(4)15(3)10-17-11-19(30-5)24(31-6)26(32-7)21(17)22-18(23)12-20-25(27(22)33-8)35-13-34-20/h9,11-12,15-16,23H,10,13H2,1-8H3/b14-9-/t15-,16-,23+/m1/s1 |
InChI Key | PZUDCPSZWPLXKT-FSAHGXKXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O8 |
Molecular Weight | 498.60 g/mol |
Exact Mass | 498.22536804 g/mol |
Topological Polar Surface Area (TPSA) | 81.70 Ų |
XlogP | 5.80 |
There are no found synonyms. |
![2D Structure of [(9R,10R,11S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] (Z)-2-methylbut-2-enoate 2D Structure of [(9R,10R,11S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4c4b5b80-86fd-11ee-a080-dbd3411ecb28.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.97% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.71% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.25% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.45% | 89.00% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 91.09% | 96.76% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.08% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.93% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.49% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.43% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.35% | 92.62% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.30% | 95.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.39% | 96.77% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.02% | 82.67% |
CHEMBL2535 | P11166 | Glucose transporter | 86.26% | 98.75% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.87% | 94.80% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.17% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.06% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.48% | 91.19% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.71% | 98.75% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.17% | 96.86% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.10% | 80.96% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.26% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guarea guidonia |
Kadsura heteroclita |
PubChem | 101620877 |
LOTUS | LTS0077807 |
wikiData | Q105190318 |